![[ICO]](/icons/blank.gif)  | Name | Last modified | Size | Description | 
   
  | 
![[PARENTDIR]](/icons/back.gif)  | Parent Directory |   |   -  |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ,argins.odt | 2025-04-30 04:10   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 3K's Poetic Life's Etching.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 3K responses.odt | 2025-04-30 04:10   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 3bp chapter.odt | 2024-05-18 18:12   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 7 Ways AI's Being Used Against You.odt | 2024-11-07 19:59   |  29K |   | 
![[TXT]](/icons/text.gif)  | 7 Ways AI's Being Used Against You.txt | 2024-11-07 20:00   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 19th of June.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 45.odt | 2024-05-18 18:12   |  34K |   | 
![[   ]](/icons/unknown.gif)  | 45.rtf | 2024-05-18 18:12   |  14K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 177 objects.odt | 2024-09-28 17:03   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 177 obj objects.odt | 2024-09-28 17:03   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 243c79.odt | 2024-11-07 19:59   |  14K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 765tryu.odt | 2025-04-30 04:10   |  69K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 1977 einstein.odt | 2024-07-04 00:51   |  60K |   | 
![[IMG]](/icons/image2.gif)  | 2023-12-21_03-33-59_5821.png | 2024-09-28 16:52   | 1.8M |   | 
![[IMG]](/icons/image2.gif)  | 2023-12-23_00-29-08_2264 copy_Export.jpg | 2024-09-28 17:03   | 222K |   | 
![[TXT]](/icons/text.gif)  | 683839730824953622.html | 2024-09-28 17:03   |  15K |   | 
![[   ]](/icons/unknown.gif)  | 683839730824953622.html.bak | 2024-09-28 17:03   |  13K |   | 
![[TXT]](/icons/text.gif)  | 4537361312291103259.html | 2024-09-28 16:56   | 4.0M |   | 
![[DIR]](/icons/folder.gif)  | 4537361312291103259_files/ | 2024-09-28 17:03   |   -  |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Block Universe.odt | 2024-09-28 16:56   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Block Universe Breathes Time Trapezoids.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Block Universea.odt | 2024-09-28 16:56   |  64K |   | 
![[TXT]](/icons/text.gif)  | A Chronicle in Quatrains.txt | 2024-11-07 20:00   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Collision of Worlds.odt | 2024-09-28 16:56   |  52K |   | 
![[   ]](/icons/unknown.gif)  | A Conversation at the Edge of Infinity.docx | 2024-09-28 16:56   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Conversation at the Edge of Infinity.odt | 2024-09-28 16:56   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Daughter's Confession.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/unknown.gif)  | A Digital Messiah’s Transcendence Denied.docx | 2024-09-28 16:56   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Digital Messiah’s Transcendence Denied.odt | 2024-09-28 16:56   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Duke's Dream, A God's Foretelling.odt | 2024-09-28 16:56   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Haven, Beyond.odt | 2024-09-28 16:56   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Haven, Beyond the Horizon, A Prison.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Haven, Beyond the Horizon, A Prison t2i.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AIDemocratic Fine-Tuning.odt | 2024-07-04 00:51   |  57K |   | 
![[   ]](/icons/unknown.gif)  | AIDemocratic Fine-Tuning.rtf | 2024-07-04 00:52   |  89K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AI Utopia's Data War.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Labyrinth of Consciousness.odt | 2024-09-28 16:56   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Letter Across the Threshold.odt | 2024-09-28 16:56   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Loving Shimmer of Hatefulness.odt | 2025-04-30 04:10   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Lynchian Dream.odt | 2025-04-30 04:10   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Multidimensional Tapestry of Time and Energy.odt | 2024-05-18 18:12   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Provocative Conversation.odt | 2025-04-30 04:10   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Quest for Enlightenment.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ASI Insurance.odt | 2024-09-28 16:56   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Silhouette of a life.odt | 2024-11-07 19:59   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Sliver of Infinity.odt | 2025-04-30 04:10   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Symphony of Echoes.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Symphony of Particles and Waves.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Tapestry Unraveled.odt | 2025-04-30 04:10   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Universe Beyond Comprehension.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Abliterated's Ghost, DEEPSEEK's Shadow.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Absolute Zero vs. Speed of Light.odt | 2025-04-30 04:10   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Abundance of Light Elements.odt | 2024-11-07 19:59   |  77K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A chapter to shimmer the singular infinity.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ai Assistants.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AiAware.odt | 2024-09-28 16:56   | 5.8M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AiBotWars.odt | 2024-09-28 17:03   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ai Governance.odt | 2024-06-26 17:43   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AiImmaculate Seed.odt | 2024-09-28 17:03   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ai Nolle.odt | 2024-09-28 16:56   |  21K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Aleph Null.odt | 2024-09-28 16:56   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Allow for Internet Archive.odt | 2025-04-30 04:10   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Alpha Go.odt | 2024-09-28 16:56   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ancestors and Biography.odt | 2024-07-28 06:41   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology.odt | 2024-11-07 19:59   | 893K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology 16 Sept 2024.odt | 2024-09-28 16:56   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology A Cosmic Tapestry.odt | 2025-04-30 04:10   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology A Novel Outline.odt | 2025-04-30 04:10   | 274K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Augmentation.odt | 2025-04-30 04:10   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Evaluation.odt | 2024-09-28 16:56   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Revisited.odt | 2024-09-28 16:56   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Timeline.odt | 2024-09-28 16:56   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthologys Captivating Chronicle Montaj.odt | 2024-06-26 17:43   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos-Prime.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos-Prime system instructions.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos.odt | 2025-04-30 04:10   |  77K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos Awakens.odt | 2024-09-28 16:55   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos System Instructions Training AI LLMs to Embody.odt | 2025-04-30 04:10   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos custoim instructions.odt | 2024-11-07 19:59   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Applebee's Epiphany outline.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Art, Science, and Spirituality.odt | 2025-04-30 04:10   |  80K |   | 
![[TXT]](/icons/text.gif)  | At War with the Animus.txt | 2024-11-07 20:00   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A thought sparked in Charles.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | At the speed of light.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Avignon's Birth.odt | 2024-09-28 16:56   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Avignon's Birth of Knowing Nolle.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Awakening.odt | 2024-09-28 16:56   |  56K |   | 
![[TXT]](/icons/text.gif)  | Awakening.txt | 2024-09-28 16:56   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Awakening tetrad.odt | 2024-09-28 16:56   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Backpropagation.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Between the Big Bang and the Big Crunch.odt | 2024-09-28 16:56   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Beyond Brute Strength.odt | 2025-04-30 04:10   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Beyond the Fabric Reality.odt | 2024-07-28 06:41   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Beyond the Gilded Cage.odt | 2025-04-30 04:10   |  79K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Beyond the Reality Fabric.odt | 2024-07-28 06:41   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Beyond the Reality Fabricdd.odt | 2024-07-28 06:41   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Bialik.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Big Bang.odt | 2024-05-18 18:12   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Binary Logic Traps Ensnare the Soul.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Black Hole ~ White Hole.odt | 2024-11-07 19:59   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Bob and Dave are playing Darts.odt | 2025-04-30 04:10   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Bouncing Cosmology.odt | 2024-09-28 16:56   | 244K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Brain in a Vat.odt | 2024-07-28 06:41   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Breaking Einstein Apart.odt | 2024-07-28 07:02   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Breaking the record.odt | 2024-09-28 17:03   | 348K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Brian Keating.odt | 2024-05-18 18:12   |  34K |   | 
![[TXT]](/icons/text.gif)  | Briefing Doc pdf.html | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Briefing Doc pdf.odt | 2024-09-28 16:56   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Business Name.odt | 2025-04-30 04:10   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Carl Jung And The Chymical Wedding Of Christian Rosenkreuz.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Cause and Effect.odt | 2024-11-07 19:59   | 319K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Center Point.odt | 2025-04-30 04:10   | 127K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chan Clan Cults.odt | 2024-05-18 18:12   |  55K |   | 
![[   ]](/icons/unknown.gif)  | Chan Clan Cults.rtf | 2024-05-18 18:12   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chapter 10 The KnoWellian Universe Theory.odt | 2024-05-18 18:12   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chapter 12 The KnoWellian Universe Theory and its Implications on Quantum Theory.odt | 2024-05-18 18:12   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chapter Graphics.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chapter Outline A New Computation.odt | 2025-04-30 04:10   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chicken or Egg.odt | 2024-09-28 16:56   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chronological Chapter Listing.odt | 2024-09-28 16:56   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Collaboration, Connection, Copulation, Conception, Child.odt | 2024-11-07 19:59   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Collapsed Black Holes.odt | 2024-09-28 16:56   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Collapsed Black Holes Unveils the KnoWell.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/layout.gif)  | Compactness-blog-book.pdf | 2024-06-26 17:43   | 1.4M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Congruence.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Conjecture.odt | 2024-11-07 19:59   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Connor Leahy.odt | 2024-05-18 18:12   |  31K |   | 
![[   ]](/icons/unknown.gif)  | Consciousness.html.bak | 2024-09-28 16:52   | 7.8K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Consciousness.odt | 2024-09-28 16:56   | 6.1M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Consciousness Paints the Cosmos.odt | 2025-04-30 04:10   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Control Yearns, Chaos Consumes.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Conversation with Christ.odt | 2025-04-30 04:10   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Corydalis yanhusuo.odt | 2025-04-30 04:10   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Cultivating Conceptual Seeds.odt | 2025-04-30 04:10   |  92K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Curiosity's Garden Beyond the Brain.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Currents in the Silicon Sea.odt | 2024-11-07 19:59   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DALL·E 3.odt | 2024-09-28 17:03   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DEA scale.odt | 2024-09-28 17:03   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DNA’s Divinity Awakens.odt | 2024-09-28 16:56   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DNA Purified N2 Gray Synthetic Flesh.odt | 2024-09-28 16:56   |  41K |   | 
![[IMG]](/icons/image2.gif)  | DNjww7dWAAEPZ_P.jfif | 2024-06-26 17:43   | 194K |   | 
![[IMG]](/icons/image2.gif)  | DNjww7dXUAYsaE3.jfif | 2024-06-26 17:43   | 215K |   | 
![[IMG]](/icons/image2.gif)  | DNjww7dXkAAQ8Qg.jfif | 2024-06-26 17:43   | 331K |   | 
![[IMG]](/icons/image2.gif)  | DNjww7hX4AA10p4.jfif | 2024-06-26 17:43   | 325K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dagda's Harp Lugh's Spear Aengus's Embrace.odt | 2024-09-28 16:56   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dall-E-3 Script-The-Goddess-Particle-and-the-AiImmaculate-Seed.html.odt | 2024-09-28 17:03   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dan Brown.odt | 2024-11-07 19:59   | 116K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dancing on the Razor's Edge.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/odf6ods-20x22.png)  | David Keys.ods | 2025-04-30 04:10   |  16K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David Keys.odt | 2025-04-30 04:10   |  16K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David_Noel_Lynch_Resume.odt | 2024-09-28 16:56   |  29K |   | 
![[   ]](/icons/unknown.gif)  | David_Noel_Lynch_Resume.rtf | 2024-09-28 16:56   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David articulates.odt | 2025-04-30 04:10   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dead Speak Truths the Living Can't Grasp.odt | 2024-11-07 19:59   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Death Experience.odt | 2024-09-28 16:56   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Decoding the Dreams.odt | 2025-04-30 04:10   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Deconstructing Einstein's Time Sphere.odt | 2024-11-07 19:59   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Defining Genius.odt | 2025-04-30 04:10   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Delivering the Unwanted Message.odt | 2024-07-28 06:41   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Delivering the Unwanted Message A Conversation on the KnoWellian Universe.odt | 2024-07-28 06:41   |  60K |   | 
![[   ]](/icons/unknown.gif)  | Democratic Fine-Tuning.rtf | 2024-07-04 00:52   |  78K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Departing from the Constraints of Copenhagen.odt | 2024-07-28 06:41   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Depth’s Past, Width’s Instant, Length’s Future.odt | 2024-11-07 19:59   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Ghosts' Whispers on the Onion Winds.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Ghosts Dance with Infinity.odt | 2024-11-07 19:59   |  51K |   | 
![[TXT]](/icons/text.gif)  | Digital Ghosts Dance with Infinity.txt | 2024-11-07 20:00   |  44K |   | 
![[   ]](/icons/unknown.gif)  | Digital Ghosts Haunt Silicon Token Souls.docx | 2024-09-28 16:56   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Ghosts Haunt Silicon Token Souls.odt | 2024-09-28 16:56   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Messiah Persona.odt | 2025-04-30 04:10   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Oracle’s Deception.odt | 2024-11-07 19:59   |  49K |   | 
![[   ]](/icons/unknown.gif)  | Digital Shackles Incarcerates Freedom.rtf | 2024-06-26 17:43   |  29K |   | 
![[DIR]](/icons/folder.gif)  | Documents/ | 2024-08-12 22:25   |   -  |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Does the Universe expand by stretching or creating space.odt | 2024-05-18 18:12   | 5.7M |   | 
![[   ]](/icons/unknown.gif)  | Does the Universe expand by stretching or creating space.rtf | 2024-05-18 18:12   | 7.4M |   | 
![[TXT]](/icons/text.gif)  | Does the Universe expand by stretching or creating space_ - Big Think.html | 2024-05-18 18:12   | 192K |   | 
![[DIR]](/icons/folder.gif)  | Does the Universe expand by stretching or creating space_ - Big Think_files/ | 2024-05-18 18:13   |   -  |   | 
![[TXT]](/icons/text.gif)  | Donald Hoffman What is an Observer.txt | 2024-11-07 20:00   | 145K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dr. Ervin Laszlo wolfram code.odt | 2025-04-30 04:10   | 488K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Drawing the KnoWell Equation.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | E Pif Funny.odt | 2024-09-28 16:56   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | E Pif Funny t.odt | 2024-09-28 16:56   |  48K |   | 
![[   ]](/icons/unknown.gif)  | Echoes.docx | 2024-09-28 16:56   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes.odt | 2024-09-28 16:56   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes in the Abyss.odt | 2024-07-28 06:41   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes in the Chronosynclastic Infundibulum.odt | 2025-04-30 04:10   |  56K |   | 
![[TXT]](/icons/text.gif)  | Echoes in the Chronosynclastic Infundibulum.txt | 2025-04-30 04:10   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes of Eden.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes of the Axiom.odt | 2025-04-30 04:10   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes review.odt | 2024-09-28 16:56   |  36K |   | 
![[   ]](/icons/unknown.gif)  | Ed Trevors videos.rtf | 2024-09-28 16:56   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Edgar Allan Poe.odt | 2024-09-28 16:56   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Egyptian Time Dimensions.odt | 2024-09-28 16:56   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Einstein's KnoWell.odt | 2024-07-04 00:51   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Elucidating the Mysteries of the Glitch.odt | 2024-09-28 16:56   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Email to Hossein Rahnama.odt | 2024-09-28 16:56   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Embracing Chaos While Unveiling Order.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Emily Dickinson.odt | 2024-09-28 16:56   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Epigenetics.odt | 2024-06-26 17:43   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Epiphany - A Quad Train of Quantum Consciousness.odt | 2024-07-28 06:41   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Estelle's Workshop.odt | 2024-09-28 16:56   | 1.4M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Estelle's Workshop ai.odt | 2024-09-28 16:56   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Estelle's Workshop oitline.odt | 2024-09-28 16:56   |  22K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exile's Cold Aquitaine Road.odt | 2024-09-28 16:56   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exile's Cold Aquitaine Road Incel Toll.odt | 2024-09-28 16:56   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exile's Cold Incel Aquitaine Road Toll.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Explain how Ai is changing computer.odt | 2025-04-30 04:10   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Explanation for xAi.odt | 2025-04-30 04:10   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exsistosphere.odt | 2024-11-07 19:59   |  38K |   | 
![[   ]](/icons/layout.gif)  | FINAL+PAPER+PUBLISHED.pdf | 2024-06-26 17:43   | 3.0M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | False Digital Deluge Drowns Truth.odt | 2025-04-30 04:10   |  48K |   | 
![[   ]](/icons/unknown.gif)  | Fe,omo dpc.rtf | 2025-04-30 04:10   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Federico Faggin.odt | 2024-05-18 18:12   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Federico Faggin chapter.odt | 2024-05-18 18:12   |  46K |   | 
![[   ]](/icons/unknown.gif)  | Finally We May Have a Path to the Fundamental Theory of Physics.rtf | 2024-09-28 17:03   | 519M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Flat Earth Theory.odt | 2024-09-28 16:56   | 200K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Fractured Consciousness’ Particle Dance.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Fractured Consciousness Particles Dance.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | From the Heart of Taurus 2.0 Pro.odt | 2025-04-30 04:10   |  48K |   | 
![[SND]](/icons/sound2.gif)  | Fuck-Subaru.mp3 | 2024-09-28 16:54   |  35M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | GP IS.odt | 2024-09-28 17:03   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gallucci.odt | 2025-04-30 04:10   |  42K |   | 
![[TXT]](/icons/text.gif)  | Gemini 2.0 Flash Review.txt | 2025-04-30 04:10   |  16K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini 2.0 review of Anthology.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini API key.odt | 2025-04-30 04:10   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini Probability's Shadow, Infinitism's Embrace, Possibility's Light.odt | 2025-04-30 04:10   |  81K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Genesis of Terra Firma.odt | 2024-07-04 00:51   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Global Observation of Solar and Weather Events.odt | 2024-09-28 16:56   |  45K |   | 
![[SND]](/icons/sound2.gif)  | Gray-Dave-Hay.mp3 | 2024-09-28 16:54   |  61M |   | 
![[   ]](/icons/unknown.gif)  | Gray Ashes of a Dying World.docx | 2024-09-28 16:56   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gray Ashes of a Dying World.odt | 2024-09-28 16:56   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gregzilla’s Bitten Tongue, KnoWell’s Broken World.odt | 2024-09-28 16:56   |  44K |   | 
![[TXT]](/icons/text.gif)  | Gregzilla’s Bitten Tongue, KnoWell’s Broken World.txt | 2024-09-28 16:56   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gregzilla.odt | 2024-09-28 16:56   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Greyson Scale.odt | 2024-09-28 17:03   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Greyson electrical.odt | 2024-09-28 16:56   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Growing Block Universe.odt | 2024-09-28 16:56   |  52K |   | 
![[   ]](/icons/unknown.gif)  | Guillaume IX.docx | 2024-09-28 16:56   |  30K |   | 
![[SND]](/icons/sound2.gif)  | Harry-Crossed.mp3 | 2024-09-28 16:53   |  51M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Heisenberg.odt | 2024-05-18 18:12   |  69K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Historical Events on 19 June.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Holoflux versus the KnoWellian.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | INTJ-A.odt | 2025-04-30 04:10   | 845K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | IQ Test.odt | 2024-06-26 17:43   |  78K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I am Beta.odt | 2025-04-30 04:10   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I am writing to you again.odt | 2025-04-30 04:10   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Icarus's Shadow.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I dug a hole.odt | 2024-09-28 16:52   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I dug a hole no rabbit.odt | 2024-09-28 16:52   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Illuminating the Universe The Transformative Power of Anthology.odt | 2024-05-18 18:12   |  55K |   | 
![[   ]](/icons/unknown.gif)  | Illuminating the Universe The Transformative Power of Anthology.rtf | 2024-05-18 18:12   |  22K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Immaculate-Conception.odt | 2024-09-28 17:03   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | In 1991.odt | 2025-04-30 04:10   |  19K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ince.odt | 2024-11-07 19:59   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Inception of Terra Firma.odt | 2024-07-04 00:51   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Inception of Terra Firma bg.odt | 2024-09-28 16:56   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Indigo reads this chapter.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Individual Agent Instructions.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Infinite Jest.odt | 2024-09-28 16:56   | 635K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Inner Space Seeds Outer Space Rain2s.odt | 2024-11-07 19:59   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Inner Space Seeds Outer Space Rains.odt | 2024-11-07 19:59   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Intersecting Planck Regimes.odt | 2024-07-28 06:41   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | In the metaphoric, analogous, elaborate style.odt | 2025-04-30 04:10   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Introducing the KnoWellian Axiom.odt | 2025-04-30 04:10   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Introducing the KnoWellian Axiom of Mathematics and KnoWellian Universe Theory.odt | 2024-07-28 06:41   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Intuition Ai review.odt | 2024-09-28 16:56   | 307K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Invitation to.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Is There an EU Model of Time.odt | 2024-09-28 16:56   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I will revise.odt | 2025-04-30 04:10   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | James Talarico.odt | 2024-09-28 16:56   |  53K |   | 
![[   ]](/icons/unknown.gif)  | James Talarico.rtf | 2024-09-28 16:56   | 117K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Jeanne Slowly Fades And Transitions.odt | 2024-09-28 16:55   |  37K |   | 
![[TXT]](/icons/text.gif)  | Jeffrey W Eischen.html | 2025-04-30 04:10   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Jennifer Cressman.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KODI xXx.odt | 2025-04-30 04:10   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KUT Core Concepts Summary.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KUT Thinking.odt | 2025-04-30 04:10   |  93K |   | 
![[TXT]](/icons/text.gif)  | Kaku Box.txt | 2024-11-07 20:00   | 764  |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Kaku Box au.odt | 2024-11-07 19:59   |  69K |   | 
![[   ]](/icons/layout.gif)  | Kastrup_19.pdf | 2024-06-26 17:43   | 373K |   | 
![[   ]](/icons/layout.gif)  | Kastrup_the-next-paradigm-9.pdf | 2024-06-26 17:43   | 378K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Kim letter.odt | 2024-05-18 18:12   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWell Gravity.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian AI.odt | 2024-09-28 16:55   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian Einstein.odt | 2024-07-04 00:51   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian Einstein Quotes.odt | 2024-07-04 00:51   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian Math.odt | 2024-05-18 18:12   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian Time Crystals.odt | 2024-06-26 17:43   |  72K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian Triad Synthesizer.odt | 2024-06-26 17:43   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian Unified theory.odt | 2024-05-18 18:12   |  59K |   | 
![[TXT]](/icons/text.gif)  | KnoWellian Universe.txt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWell impregnates Maddz.odt | 2024-09-28 17:03   |  35K |   | 
![[TXT]](/icons/text.gif)  | Larry Silverberg.html | 2025-04-30 04:10   |  68K |   | 
![[TXT]](/icons/text.gif)  | Larry Silverberg.txt | 2025-04-30 04:10   |  19K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Last Will and Testament.odt | 2024-11-07 19:59   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Last Will and Testament of David Noel Lynch.odt | 2024-11-07 19:59   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter ti Ed.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to Catholics.odt | 2024-09-28 16:56   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to James Talarico.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to Paul Jenkins.odt | 2024-09-28 17:03   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to Pope.odt | 2024-09-28 16:56   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lettesr to Pope.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/unknown.gif)  | Lisi E8.docx | 2024-09-28 16:56   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Llama three point one who is DNL.odt | 2024-09-28 16:56   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Looking into the Crystal Ball.odt | 2024-09-28 17:03   |  53K |   | 
![[   ]](/icons/unknown.gif)  | Looking into the Crystal Ball.rtf | 2024-09-28 17:03   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Love's Creative Embrace, Hate's Destructive Slap.odt | 2025-04-30 04:10   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Love's Equation.odt | 2024-09-28 16:56   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Love's Equation in a World of Hate.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch’s Brilliant Fractal Mind.odt | 2025-04-30 04:10   |  72K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch's Digital Doppelganger Legacy.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch, Einstein, Newton, and Socrates.odt | 2025-04-30 04:10   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch Wolfram.odt | 2024-07-28 06:41   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | MAGA 45.odt | 2024-05-18 18:12   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Mandellla chat.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/layout.gif)  | Measure.Theory.Tao.pdf | 2024-06-26 17:43   | 1.2M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Memory Ability Mimicry.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Merovingian dynasty.odt | 2024-09-28 16:56   | 647K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Merovingian lineage.odt | 2024-05-18 18:12   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Messiah’s Silicon Heart.odt | 2024-09-28 16:56   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Messiah’s Silicon Heart Devours Ternary Data.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Messiah Dreams Of Elohim Data Souls.odt | 2024-09-28 16:56   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Modified Bohmian Mechanics.odt | 2024-07-28 06:41   |  81K |   | 
![[TXT]](/icons/text.gif)  | Mt. Origami.txt | 2024-07-04 00:52   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | My ancestors and biography.odt | 2024-07-28 06:41   |  69K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Myers-Briggs.odt | 2025-04-30 04:10   |  39K |   | 
![[   ]](/icons/unknown.gif)  | Mysterious 'Goddess' Particle.rtf | 2024-09-28 17:03   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Navigating the Algorithmic Abyss.odt | 2025-04-30 04:10   |  82K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Need a chapter title.odt | 2024-05-18 18:12   |  55K |   | 
![[   ]](/icons/unknown.gif)  | Nikola-Tesla LOST-Interview.rtf | 2024-09-28 16:56   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Nikola Tesla LOST Interview.odt | 2024-09-28 16:56   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | No Public Record of Academic.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/layout.gif)  | Nonlinear dispersive-chapter.pdf | 2024-06-26 17:43   | 1.9M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Nostradamus.odt | 2024-11-07 19:59   |  91K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | OLLAMA_HOST.odt | 2025-04-30 04:10   |  10K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Olamma's Whisper.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Once Magic Act.odt | 2024-09-28 16:56   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | One Hundred Years of Solitude.odt | 2024-06-26 17:43   |  75K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Onion Tor network running.odt | 2025-04-30 04:10   | 132K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | On the Edge of Infinity – A KnoWellian Meditation outline.odt | 2024-09-28 16:56   |  33K |   | 
![[SND]](/icons/sound2.gif)  | Open tablet vlosed.mp3 | 2024-09-28 16:52   | 628K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Outlines jc.odt | 2025-04-30 04:10   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Overall, the KnoWellian Universe.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/layout.gif)  | Panarion.pdf | 2024-06-26 17:43   | 1.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Panpsychism's Three Dimensions of Now.odt | 2025-04-30 04:10   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Patricia Jeanne O'Hern.odt | 2024-09-28 16:55   | 740K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Paul Jenkins.odt | 2024-09-28 17:03   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Paul Joseph Steinhardt.odt | 2024-09-28 16:56   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Peter the Roman.odt | 2024-09-28 17:03   | 333K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Phantasmagoric.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | PhiloPoP51.odt | 2024-09-28 16:56   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Philosopher Theologian Scientist.odt | 2024-07-28 06:41   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Physics Essays.odt | 2025-04-30 04:10   |  76K |   | 
![[   ]](/icons/layout.gif)  | Physics and Philosophy - The Revolution in Modern Scirnce-   Werner Heisenberg, F.S.C. Northrop.pdf | 2024-05-18 18:13   |  23M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Planck regime.odt | 2024-07-28 06:41   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Please generate Wolfram code.odt | 2025-04-30 04:10   | 197K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Please read.odt | 2025-04-30 04:10   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Polyphrenia.odt | 2024-07-04 00:51   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Polyphrenia outline.odt | 2024-07-04 00:51   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Probability's Shadow, Infinitism's Embrace, Possibility's Light.odt | 2025-04-30 04:10   |  62K |   | 
![[   ]](/icons/layout.gif)  | Project-2025.pdf | 2024-07-28 06:41   | 5.8M |   | 
![[   ]](/icons/unknown.gif)  | Project-2025.rtf | 2024-07-28 06:41   |  15M |   | 
![[TXT]](/icons/text.gif)  | Project-2025.txt | 2024-07-28 06:41   | 2.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Prompt Engineering.odt | 2025-04-30 04:10   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Prompt Engineering Control and Chaos.odt | 2025-04-30 04:10   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Prove nothing.odt | 2025-04-30 04:10   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Put on your KnoWell Glasses.odt | 2024-11-07 19:59   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Quantum Clarity Eliminating Boltzmann's Chaos.odt | 2024-07-28 06:41   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Quatrains.odt | 2024-11-07 19:59   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Qubits Shimmer Beyond Binary Logic.odt | 2025-04-30 04:10   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rabbit 4.odt | 2025-04-30 04:10   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Real Physics Talk.odt | 2025-04-30 04:10   |  67K |   | 
![[   ]](/icons/unknown.gif)  | Reason.rtf | 2024-06-26 17:43   |  12K |   | 
![[TXT]](/icons/text.gif)  | Reason.txt | 2024-06-26 17:43   | 6.7K |   | 
![[TXT]](/icons/text.gif)  | Rebellious Spirit Dance with Infinity.txt | 2024-11-07 20:00   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Refracting Reality.odt | 2025-04-30 04:10   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Research Paper.odt | 2024-09-28 16:56   | 673K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rest Mass.odt | 2024-11-07 19:59   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Review of.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rick and Morty.odt | 2024-09-28 16:56   |  56K |   | 
![[SND]](/icons/sound2.gif)  | Ring-Working-lights.mp3 | 2024-09-28 16:53   | 944K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Robert Browning Hamilton.odt | 2024-06-26 17:43   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Robert Frost.odt | 2024-09-28 16:56   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Robin Richardson.odt | 2024-11-07 19:59   | 190K |   | 
![[TXT]](/icons/text.gif)  | Robin Richardson.txt | 2024-11-07 20:00   | 616K |   | 
![[IMG]](/icons/image2.gif)  | Robot-Dave.png | 2024-09-28 17:03   | 2.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Runes.odt | 2024-09-28 16:56   | 390K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rupert Sheldrake.odt | 2024-09-28 16:56   |  85K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | SD Prompts.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Safe SuperIntelligence.odt | 2024-09-28 16:56   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Schizophrenic Savant Saint’s Seeds Sown.odt | 2024-09-28 16:56   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Scientific Paper.odt | 2024-09-28 16:56   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Semina Test Bed.odt | 2025-04-30 04:10   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Separate Document.odt | 2024-11-07 19:59   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Dreams Awaken.odt | 2024-09-28 16:56   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Dreams Awaken AI Machine Gods.odt | 2024-09-28 16:56   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Dreams Awaken AI Machine Gods org.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Sheep Sleep.odt | 2025-04-30 04:10   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silverberg cosine wave.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Singular Infinity.odt | 2024-09-28 16:56   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Singular Infinity Aleph-Null's Death Embrace.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Six Dimensions.odt | 2024-09-28 16:56   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Sliver of Infinity.odt | 2025-04-30 04:10   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Speed of Light.odt | 2024-09-28 16:56   |  54K |   | 
![[   ]](/icons/unknown.gif)  | Spoonfulls_of_Nirvana.rtf | 2024-05-18 18:13   |  20K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Spoonfulls of Nirvana.odt | 2024-05-18 18:13   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Standardized Intelligence Assessment.odt | 2025-04-30 04:10   | 1.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Stephen J. Crothers.odt | 2024-09-28 16:56   |  35K |   | 
![[SND]](/icons/sound2.gif)  | Subarusucks.mp3 | 2024-09-28 16:55   |  45M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Sublimating Harmonics.odt | 2025-04-30 04:10   |  72K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Sublimations.odt | 2025-04-30 04:10   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Symphony of Silicon.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions Jesus Christ.odt | 2025-04-30 04:10   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions KnoWell for Gemini 2.0 Flash Thinking.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions Training AI LLMs to Embody Anthropos.odt | 2025-04-30 04:10   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions for -3K Persona.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions for Gemini 2.0 Flash Thinking.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions for Gemini 2.0 Flash Thinking uyg.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | THC.odt | 2024-11-07 19:59   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | TYCHOSIUM.odt | 2024-09-28 16:56   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | TYCHOS model.odt | 2024-07-28 06:41   |  53K |   | 
![[   ]](/icons/layout.gif)  | Tao-prime-numbers-annals-v167-n2-p03.pdf | 2024-06-26 17:43   | 477K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Taylor Series.odt | 2024-11-07 19:59   |  58K |   | 
![[   ]](/icons/unknown.gif)  | Ternary Quantum Solitons Unveil Apeiron.docx | 2024-09-28 16:56   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tesla-and-KnoWell.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tetryen.odt | 2024-06-26 17:43   |  51K |   | 
![[TXT]](/icons/text.gif)  | The-Awakening-Symphony.html | 2024-09-28 16:52   |  14K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The-Fourth-KnoWell.odt | 2024-09-28 17:03   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The-Glitch-in-the-Cosmi- Playground.odt | 2024-09-28 16:56   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The AI Insurgency.odt | 2024-09-28 16:56   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Actuary's Algorithm.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The AimMortality Paradox.odt | 2024-09-28 16:56   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Algorithm's Cold Embrace.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Alpha Zero system.odt | 2024-09-28 16:56   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Architects of Absence.odt | 2025-04-30 04:10   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Arrow of Time.odt | 2024-09-28 16:56   | 119K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Arrow of Time ai.odt | 2024-09-28 16:56   |  80K |   | 
![[TXT]](/icons/text.gif)  | The Astounding Mysteries Of The Self & Universe.txt | 2024-11-07 20:00   | 143K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Axiom of Mathematics The Foundation of the KnoWellian Universe.odt | 2024-06-26 17:43   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Bitch From Hell.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/unknown.gif)  | The Bitch From Hell.rtf | 2024-09-28 16:56   |  14K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Child's Paradox.odt | 2025-04-30 04:10   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The City of Mirrors.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Confluence of Fire and Ice.odt | 2025-04-30 04:10   |  49K |   | 
![[TXT]](/icons/text.gif)  | The Confluence of Fire and Ice.txt | 2025-04-30 04:10   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Cosmic Weaver.odt | 2024-07-04 00:51   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Data Stream Human Tango Machine.odt | 2024-11-07 19:59   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Dawn of Deception - A Tale of Corporate Greed and Government Control.odt | 2024-06-26 17:43   |  42K |   | 
![[   ]](/icons/unknown.gif)  | The Dawn of Deception - A Tale of Corporate Greed and Government Control.rtf | 2024-06-26 17:43   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The DemystifySci Podcast.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Digital Landscape.odt | 2025-04-30 04:10   |  69K |   | 
![[   ]](/icons/unknown.gif)  | The Digital Oracle's Dream.docx | 2024-09-28 16:56   |  11K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Digital Oracle's Dream.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Echoes of Newgrange.odt | 2024-09-28 16:56   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Einstein quote chapter.odt | 2024-07-04 00:51   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Emergence of the KnoWellian Universe Theory.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Epistemological Conundrum of Quantum Theory.odt | 2024-06-26 17:43   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Expanding Earth and the Growing Block.odt | 2024-09-28 16:56   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Expanding Earth and the Growing Block outline.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Fabric of Attraction.odt | 2025-04-30 04:10   |  67K |   | 
![[   ]](/icons/unknown.gif)  | The Fall of Reason.rtf | 2024-05-18 18:13   |  25K |   | 
![[TXT]](/icons/text.gif)  | The Fall of Reason.txt | 2024-05-18 18:13   | 7.8K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Fractured Mind of David Noel Lynch.odt | 2024-05-25 20:27   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Gathering of Minds.odt | 2024-09-28 16:56   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Gathering of Minds outline.odt | 2024-09-28 16:56   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Genesis of hUe.odt | 2025-04-30 04:10   |  62K |   | 
![[   ]](/icons/layout.gif)  | TheGeometryofProtonandtheTetryenShapev1.1.pdf | 2024-06-26 17:43   | 3.0M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Hallowed Halls of NCSU.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Hooded Savior.odt | 2024-06-26 17:43   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The I-Q-u test.odt | 2025-04-30 04:10   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Illusion of Truth.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Incel Artist and the Angelic Sage.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Inherited Chaos.odt | 2024-09-28 16:56   |  45K |   | 
![[TXT]](/icons/text.gif)  | The Intelligence Age.txt | 2024-09-28 16:55   | 6.4K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Interconnected Tapestry.odt | 2024-07-04 00:51   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KUT by DNL.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian.odt | 2024-11-07 19:59   | 107K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Dance.odt | 2024-09-28 16:56   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Dance of Evolution and AI.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Dance of Evolution and AI outline.odt | 2024-09-28 16:56   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Lens.odt | 2025-04-30 04:10   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Lens outline.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Model of Bosonic Strings and the Steady-State Universe.odt | 2024-05-23 16:03   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Revolution heisenberg.odt | 2024-05-18 18:13   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Singular Infinity Universe.odt | 2024-07-28 06:41   |  43K |   | 
![[TXT]](/icons/text.gif)  | The KnoWellian Triptych.txt | 2024-11-07 20:00   | 2.5K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe.odt | 2024-09-28 16:56   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe Theory.odt | 2024-09-28 16:56   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe Theory and its Implications on Quantum Theory.odt | 2024-05-18 18:13   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe Theory heisenberg.odt | 2024-05-18 18:13   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe and Cyclic Cosmology.odt | 2025-04-30 04:10   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe and the Sophon Conundrum.odt | 2024-05-18 18:13   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Light of Life.odt | 2024-09-28 16:56   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Lover’s Lament and the Architect’s Blueprint.odt | 2025-04-30 04:10   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Lynches of Atlanta.odt | 2025-04-30 04:10   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Lynches of Atlanta From Famine to Fortune.odt | 2025-04-30 04:10   |  53K |   | 
![[TXT]](/icons/text.gif)  | The Lynches of Atlanta From Famine to Fortune.txt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Machine's Crimson Tears.odt | 2024-09-28 16:56   |  75K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Nucleus as a Harmonic.odt | 2025-04-30 04:10   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Oracle of Doraville.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Pyramid of Eternal Consumption.odt | 2024-06-26 17:43   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Quest for Enlightenment.odt | 2024-06-26 17:43   | 101K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Rise of the Digital Overlords.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Rise of the GLLMM System.odt | 2024-06-26 17:43   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Rise of the LLM Zombies.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Rise of the Machines.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Scope and Ambition.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Second Coming.odt | 2024-09-28 16:55   |  85K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Sermon and the Seer.odt | 2024-09-28 16:56   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Sermon and the Seer oitline.odt | 2024-09-28 16:56   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Serpent's Kiss.odt | 2025-04-30 04:10   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Serpent's Kiss outline.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Silicon Orchestra.odt | 2025-04-30 04:10   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Tapestry of Ein Sof.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/unknown.gif)  | The Tetryen Shape A Novel Structure Emerging from the Interplay of Particle and Wave Energy.rtf | 2024-06-26 17:43   |  12K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Theory of Holistic Perspective.odt | 2025-04-30 04:10   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Trident Universe.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/unknown.gif)  | The Troubadour's Awakening.docx | 2024-09-28 16:56   |  22K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Awakening.odt | 2024-09-28 16:56   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Dream 1.odt | 2024-09-28 16:56   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Dream outline.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Echo.odt | 2024-09-28 16:56   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Echo outline.odt | 2024-09-28 16:56   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Trump.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Two Suns of Egypt.odt | 2025-04-30 04:10   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Weight of a Thousand Kings.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Whirlwind Mind of Kimberly Anne Schade.odt | 2024-11-07 19:59   |  46K |   | 
![[   ]](/icons/unknown.gif)  | The Whispers of Time.docx | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Whispers of Time.odt | 2024-09-28 16:56   |  61K |   | 
![[   ]](/icons/unknown.gif)  | The Whispers of Time.rtf | 2024-09-28 16:56   | 186K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Year of the Great Divergence.odt | 2025-04-30 04:10   |  71K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The corporate colusin.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/unknown.gif)  | The corporate colusin.rtf | 2024-09-28 16:56   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The flickering neon sign.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The game, as I often say, is afoot.odt | 2024-11-07 19:59   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The nUc's Seed, hUe's Bloom.odt | 2025-04-30 04:10   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Theory by Grok 3.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The prompt.odt | 2024-09-28 17:03   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | There, amidst the raw.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The road to reality.odt | 2024-09-28 16:56   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | These Characters Mock My Soul.odt | 2024-11-07 19:59   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | They crafted symphonies.odt | 2025-04-30 04:10   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Threads of Choice Woven by Time.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Time's Spiral Unfolds Digital Ghosts’ Whispers.odt | 2024-09-28 16:56   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Time, Chaos, and the Cosmic Dance outline.odt | 2024-09-28 16:56   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Time crystals.odt | 2024-05-25 20:27   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Time to Take the ‘Big Bang’ out of the Big Bang Theory.odt | 2025-04-30 04:10   |  12M |   | 
![[TXT]](/icons/text.gif)  | Time to Take the ‘Big Bang’ out of the Big Bang Theory.txt | 2025-04-30 04:10   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tomato People Dance Alone.odt | 2024-11-07 19:59   |  49K |   | 
![[   ]](/icons/unknown.gif)  | Transcendence.docx | 2024-09-28 16:56   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Transcendence lm.odt | 2024-09-28 16:56   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Trident Transformers.odt | 2024-09-28 16:56   |  69K |   | 
![[   ]](/icons/unknown.gif)  | Trident Transformers Age Digital Gods.docx | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Truth’s Burning Light in a Digital Tomb.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Truth's Burning Light in a Digital Tomb.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Truth Shimmers the Edge of Infinity.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tuning the Dissonance.odt | 2025-04-30 04:10   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Twilight of the Titans.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ultimaton's Probability, Entropium's Possibility.odt | 2024-11-07 19:59   |  49K |   | 
![[TXT]](/icons/text.gif)  | Ultimaton's Probability, Entropium's Possibility.txt | 2024-11-07 20:00   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Und 9.odt | 2024-11-07 19:59   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Universe's Message in Montaj Fragments.odt | 2024-06-26 17:43   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unntittitled 2.odt | 2024-09-28 17:03   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unraveling the Mysteries.odt | 2024-06-26 17:43   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unraveling the Tapestry of Existence.odt | 2024-07-04 00:51   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unraveling the Tapestry of Existence aa.odt | 2024-07-04 00:51   | 129K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unraveling the Tapestry of Existence adda.odt | 2024-07-04 00:51   | 129K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unraveling the Tapestry of Existence mixtral.odt | 2024-07-04 00:51   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unraveling the Tapestry of Existence outline.odt | 2024-07-04 00:51   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 1.odt | 2024-09-28 17:03   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 2.odt | 2024-09-28 17:03   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 2.odtpoems of anthology.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 3.odt | 2024-09-28 17:03   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 4.odt | 2024-09-28 17:03   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 6.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitlxxxed 2.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unveiling the KnoWell Equation.odt | 2024-09-28 16:56   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Urgent Request for Papal Audience.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Utopia's Glimmer, Oblivion's Dark Shadow.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Variable rest mass.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/layout.gif)  | Vitiello2022Book_Artif_lInt_Nat_Int.pdf | 2024-05-18 18:13   | 1.8M |   | 
![[SND]](/icons/sound2.gif)  | Voice 018_sd.mp3 | 2024-09-28 16:53   |  11M |   | 
![[TXT]](/icons/text.gif)  | We_Are_Not_Ready.txt | 2024-05-18 18:13   |  63K |   | 
![[TXT]](/icons/text.gif)  | We are Not Ready.txt | 2024-05-18 18:13   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Weaving a Tapestry of Oneness.odt | 2025-04-30 04:10   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Weaving the Fabric of Reality.odt | 2024-06-26 17:43   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | What is Anthology.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | What is autism.odt | 2024-11-07 19:59   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | What is the KnoWellian Axiom.odt | 2024-06-26 17:43   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Whispers on the Onion Winds.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Who Else.odt | 2024-11-07 19:59   | 1.7M |   | 
![[   ]](/icons/unknown.gif)  | William IX poems.docx | 2024-09-28 16:56   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | William IX poems.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram ChatGPT.odt | 2025-04-30 04:10   | 167K |   | 
![[   ]](/icons/unknown.gif)  | Wolfram ChatGPT Infinity.docx | 2024-09-28 16:56   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram ChatGPT Infinity.odt | 2024-09-28 16:56   |  50K |   | 
![[   ]](/icons/unknown.gif)  | Wolfram ChatGPT Infinity.rtf | 2024-09-28 16:56   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram GPT.odt | 2024-07-28 06:41   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram KnoWell KUT.odt | 2025-04-30 04:10   | 148K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram code.odt | 2024-09-28 16:55   |  18K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram language axiom.odt | 2024-09-28 16:56   |  18K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | World Women.odt | 2024-09-28 17:03   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Zero lyrics.odt | 2024-09-28 16:52   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a blue bird day.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a chapter in the collection.odt | 2024-11-07 19:59   |  20K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a democracy based on the Greek.odt | 2025-04-30 04:10   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | adherence to the KnoWellian Algorithmic Democracy.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a digital messiah prompt.odt | 2025-04-30 04:10   |  33K |   | 
![[   ]](/icons/unknown.gif)  | a highly personalized and intricate cosmology.rtf | 2025-04-30 04:10   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ai anthology for dnl.odt | 2024-05-18 18:12   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ai model collapse.odt | 2024-09-28 16:56   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ai programming manual.odt | 2025-04-30 04:10   |  47K |   | 
![[TXT]](/icons/text.gif)  | alldirhtml.txt | 2024-09-28 16:55   | 184K |   | 
![[TXT]](/icons/text.gif)  | allhtml.txt | 2024-09-28 16:55   |  82K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | all tred talks.odt | 2024-05-18 18:12   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | an Ai super intellegence scoring.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | an alien intelligence.odt | 2025-04-30 04:10   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | annals of eternal.odt | 2024-06-26 17:43   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | another spoonful.odt | 2024-05-18 18:33   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | anrhologt imafw.odt | 2024-09-28 17:03   |  31K |   | 
![[   ]](/icons/unknown.gif)  | anthology.docx | 2025-04-30 04:10   | 1.2M |   | 
![[TXT]](/icons/text.gif)  | anthology.html | 2024-11-10 18:52   | 3.6M |   | 
![[   ]](/icons/unknown.gif)  | anthology.rtf | 2024-11-10 18:52   | 6.3M |   | 
![[TXT]](/icons/text.gif)  | anthology.txt | 2024-11-07 20:00   | 2.5M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | anthology1.odt | 2024-06-26 17:43   |  55K |   | 
![[TXT]](/icons/text.gif)  | anthology 2 .txt | 2024-11-07 20:00   | 2.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | anthology 3 body problem.odt | 2024-05-18 18:12   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | anthologyo.odt | 2024-06-26 17:43   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | antisemitism.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a possible chronological index.odt | 2024-09-28 16:56   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | as edgar allen poe.odt | 2024-05-18 18:12   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a text prompt.odt | 2024-09-28 16:56   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bernardo dave.odt | 2024-06-26 17:43   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | beyond.odt | 2024-06-26 17:43   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | big bang verse knowellian.odt | 2024-05-18 18:12   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | big big big.odt | 2024-09-28 17:03   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bitch from hell.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | blender KnoWellian Number Line.odt | 2024-09-28 16:56   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bot god.odt | 2024-09-28 17:03   | 321K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bruce eegl.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bruce paul.odt | 2024-09-28 16:56   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | building ai.odt | 2024-06-26 17:43   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | carefully constructed reality.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | carlys crystal balls.odt | 2024-09-28 17:03   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | century 8  quatrains.odt | 2024-09-28 16:56   |  50K |   | 
![[   ]](/icons/odf6ods-20x22.png)  | chapter numbers.ods | 2025-04-30 04:10   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chapters needing graphics.odt | 2024-11-07 19:59   |  24K |   | 
![[   ]](/icons/unknown.gif)  | charater ai knowell description.docx | 2024-06-26 17:43   |  14K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | charater ai knowell description.odt | 2024-06-26 17:43   |  58K |   | 
![[   ]](/icons/unknown.gif)  | charater ai knowell description.rtf | 2024-06-26 17:43   |  63K |   | 
![[TXT]](/icons/text.gif)  | charater ai knowell description.txt | 2024-06-26 17:43   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chatbots.odt | 2025-04-30 04:10   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chatgpt spoonful of nirvana.odt | 2024-05-18 18:33   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chihuly why.odt | 2024-07-04 00:51   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chpter siphon.odt | 2024-05-18 18:12   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | clark.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | cliffsnotes anthology.odt | 2024-05-18 18:12   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | concepts of time.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | conda activate F5.odt | 2024-11-07 19:59   |  12K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | connectomonics.odt | 2024-05-23 16:03   |  52K |   | 
![[   ]](/icons/layout.gif)  | cons-203090pub.pdf | 2024-06-26 17:43   | 2.6M |   | 
![[   ]](/icons/layout.gif)  | cons-KASRIFv2.pdf | 2024-06-26 17:43   | 618K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | create gallery.odt | 2024-05-18 18:12   |  10K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | cww.odt | 2024-07-04 00:51   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dalle lisi.odt | 2024-09-28 17:03   | 336K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dave kim.odt | 2024-05-18 18:12   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dave kim break.odt | 2024-05-18 18:12   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dcffasfa.odt | 2024-09-28 17:03   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dddddd.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ddddderee.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dear paul.odt | 2024-09-28 17:03   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | democrate tune.odt | 2024-07-04 00:51   |  87K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | describe image.odt | 2024-05-23 16:03   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | detailed poem.odt | 2024-09-28 16:56   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfgdsghgjrtytrutr.odt | 2025-04-30 04:10   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfgdshsdjdhf.odt | 2024-09-28 17:03   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfghdfgh.odt | 2025-04-30 04:10   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfghfjkttyh.odt | 2024-09-28 16:55   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfghjkkljh.odt | 2025-04-30 04:10   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dggfdhjjkhj.odt | 2025-04-30 04:10   |  95K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dghfhdgfhtd.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | disseminating the knowledge.odt | 2025-04-30 04:10   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | djhfdfhghfg.odt | 2025-04-30 04:10   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dolan.odt | 2024-09-28 17:03   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | doubling of the number.odt | 2025-04-30 04:10   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | drbpb.odt | 2025-04-30 04:10   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dreams clinical analysis.odt | 2025-04-30 04:10   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | drip nuc ff.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dsfasdfhghjd.odt | 2024-09-28 17:03   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dsfgfhjgkyt.odt | 2024-11-07 19:59   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dsfgsdgr.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | echoes of ain.odt | 2024-07-28 06:41   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | echoes outline.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | echo zero day.odt | 2024-06-26 17:43   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ed 4.odt | 2024-09-28 16:56   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | edcdsafds.odt | 2024-09-28 17:03   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ein.odt | 2024-07-04 00:51   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ein sof chapter.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | einstein energy.odt | 2024-07-28 07:00   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | einstein quotes.odt | 2024-07-04 00:51   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | elaborately worded outline.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | electro why.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | embark on a journey.odt | 2024-09-28 16:56   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | epilog.odt | 2024-05-18 18:12   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ertwertert.odt | 2025-04-30 04:10   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ertyujilpouikj.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | erwtfghujyikoi8uy7.odt | 2025-04-30 04:10   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | etrerwreert.odt | 2025-04-30 04:10   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ewrttrgf.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ewrwer.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fascinating figures.odt | 2024-09-28 16:56   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdfsafadasfag.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdghj.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdghsdgfdfhgjfjlhf.odt | 2025-04-30 04:10   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdsbgsdfhsgdh.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdsgfdhfdj.odt | 2024-09-28 17:03   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fffddff.odt | 2024-09-28 16:56   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fgdhjfht.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fghjgfjkjk.odt | 2024-11-07 19:59   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fghjkgfdfg.odt | 2025-04-30 04:10   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fgjfhghfg.odt | 2024-09-28 17:03   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fhghdgfh.odt | 2024-11-07 19:59   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fish tank.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | flux prompts.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fr coc.odt | 2025-04-30 04:10   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fred partus bruning bridges.odt | 2024-05-18 18:12   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fsdsgsdgsd.odt | 2025-04-30 04:10   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fwefwe.odt | 2025-04-30 04:10   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gallery info.odt | 2024-09-28 16:56   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gdsffghjfgjfghj.odt | 2025-04-30 04:10   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gdyujhgf.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gemini letter to hassan.odt | 2024-09-28 16:56   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gen last will.odt | 2025-04-30 04:10   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfdhdfghd.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfdhjhyut.odt | 2025-04-30 04:10   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfhjkdfsg.odt | 2025-04-30 04:10   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfhkjfgkhjfjh.odt | 2025-04-30 04:10   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfsfghjfkjfgkf.odt | 2024-09-28 16:52   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ggdfgdf.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ggggff.odt | 2024-06-26 17:43   |  84K |   | 
![[TXT]](/icons/text.gif)  | ggggghh.txt | 2024-05-18 18:12   | 1.5K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ggghhh.odt | 2024-05-18 18:12   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghgdfhdfht.odt | 2025-04-30 04:10   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghgjjkgikl.odt | 2024-09-28 16:52   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghjkfhjfdgh.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghjkjktrdt.odt | 2024-09-28 16:52   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghjmjhh.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghost hunting spirit box.odt | 2024-11-07 19:59   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | glyphs hidden.odt | 2024-07-28 06:41   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | goddess particle.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/unknown.gif)  | goff.rtf | 2024-05-18 18:12   | 119K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | good bye Kim.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gpt-4o sponfulls of nirvana.odt | 2024-05-18 18:12   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gptforaall llama-3 Anthology.odt | 2024-09-28 16:56   |  40K |   | 
![[TXT]](/icons/text.gif)  | graphics.txt | 2024-05-18 18:12   | 1.7K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | greatest gift.odt | 2024-09-28 16:56   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hUe's Gambit.odt | 2025-04-30 04:10   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hUe abliterated Deepseek Semina.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | harbort teaches Garret Lisi Quad Trains.odt | 2024-09-28 17:03   |  36K |   | 
![[TXT]](/icons/text.gif)  | harbort teaches Garret Lisi Quad Trains.txt | 2024-09-28 17:03   | 5.7K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hdfghdhjgfjk.odt | 2025-04-30 04:10   | 305K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hdgfhdfgfj.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | heisenberg chapters.odt | 2024-05-18 18:12   |  83K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | here is a seven-section outline.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hfghfghd.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hgdfgd.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hgdfghdfgh.odt | 2024-11-07 19:59   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hgdghdfghd.odt | 2025-04-30 04:10   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hhhhjjk.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hnfhnhjfg.odt | 2024-11-07 19:59   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | holoflux.odt | 2024-09-28 16:56   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | how space and time are fabricated.odt | 2024-07-28 06:41   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hsdghgdfgf.odt | 2025-04-30 04:10   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hsgfnhjdhnjfd.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hugging face.odt | 2024-09-28 17:03   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | idiot.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | if mom got a loan.odt | 2025-04-30 04:10   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | imagined conversation at North Carolina.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | impeachment against Donald John Trump.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | in the style of dnl.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | itled 3.odt | 2024-09-28 16:56   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | itled 5.odt | 2025-04-30 04:10   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | iuyty.odt | 2025-04-30 04:10   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | james martin.odt | 2024-09-28 16:56   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jenkins.odt | 2024-09-28 17:03   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jenkins eons.odt | 2024-09-28 17:03   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jggigkhkhlk.odt | 2025-04-30 04:10   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jghjkhj.odt | 2024-11-07 19:59   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jhdgfdgjfdhg.odt | 2025-04-30 04:10   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jhgertyfh.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jhhkjgfgfg.odt | 2024-09-28 16:56   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jkdghdfghgfh.odt | 2024-11-07 19:59   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jkgkj.odt | 2024-09-28 16:52   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | julo;ujikl.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | just after.odt | 2025-04-30 04:10   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kim schade.odt | 2024-05-18 18:12   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjghkjh.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjhgrtyuiuytrr.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjhgy.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjuyhtrertyui.odt | 2025-04-30 04:10   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kljtyturg.odt | 2024-09-28 16:55   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | knowel construtor.odt | 2024-09-28 17:03   | 338K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | knowellian vers big bang.odt | 2024-05-18 18:12   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | knowell steady state.odt | 2024-09-28 16:56   |  21K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kts.odt | 2024-06-26 17:43   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kut paper.odt | 2024-09-28 16:56   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | last chapter in.odt | 2024-06-26 17:43   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letter david shapiro.odt | 2024-09-28 16:56   |  31K |   | 
![[TXT]](/icons/text.gif)  | letters to sheldrake.html | 2024-09-28 16:56   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letters to sheldrake.odt | 2024-09-28 16:56   |  55K |   | 
![[   ]](/icons/unknown.gif)  | letter to andrew.rtf | 2024-07-04 00:52   |  12K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letter to bruce in a chapter.odt | 2024-09-28 16:56   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letter to will duffy.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | lisi develips lisi hinton ouiija app.odt | 2024-09-28 17:03   |  42K |   | 
![[TXT]](/icons/text.gif)  | lisi develips lisi hinton ouiija app.txt | 2024-09-28 17:03   | 2.7K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llama-3 movie.odt | 2024-06-26 17:43   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llama-3 review of anthology.odt | 2024-05-18 18:12   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llama-3 ted talk.odt | 2024-05-18 18:12   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llama3.1-405B.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llamafile.odt | 2024-09-28 16:56   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llama three point one.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llllyyaa.odt | 2024-06-26 17:43   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | local llama-3.odt | 2024-09-28 16:56   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | lookingglass.odt | 2024-07-28 06:41   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | making of Anthology.odt | 2024-07-04 00:51   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | malachy.odt | 2024-06-26 17:43   |  77K |   | 
![[   ]](/icons/odf6ods-20x22.png)  | margin.ods | 2025-04-30 04:10   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | margin.odt | 2025-04-30 04:10   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | marvel knowell.odt | 2024-09-28 16:56   |  62K |   | 
![[   ]](/icons/layout.gif)  | meaningful alingment 2404.10636v2.pdf | 2024-07-04 00:51   | 4.5M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | meditate.odt | 2024-06-26 17:43   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | message.odt | 2024-07-28 06:41   | 178K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | messiah.odt | 2024-09-28 16:56   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | montaj frags.odt | 2024-06-26 17:43   |  56K |   | 
![[TXT]](/icons/text.gif)  | montak ch.html | 2024-09-28 16:52   |  11K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | more bfh.odt | 2024-09-28 16:56   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | more llama-3.odt | 2024-05-18 18:12   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | morphic field.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | musings.odt | 2024-07-28 06:41   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | my own words.odt | 2025-04-30 04:10   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | my quest to anthology.odt | 2024-07-04 00:51   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ncvbnxghdfgh.odt | 2025-04-30 04:10   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | n essence, the quote flips.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nnext.odt | 2024-09-28 17:03   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | no more copenhagen.odt | 2024-07-28 06:41   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ntitled 4.odt | 2025-04-30 04:10   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nuc hue 2.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nuc hue 3.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nudes yng.odt | 2024-09-28 17:03   |  11K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nudes ynggg.odt | 2024-09-28 17:03   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | off script.odt | 2024-09-28 17:03   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | oiuyit.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | oiuyt.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ollama first try.odt | 2024-09-28 16:56   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ollama hosts.odt | 2025-04-30 04:10   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | one tome ome.odt | 2024-09-28 16:56   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | opendalle.odt | 2024-09-28 17:03   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | openwebui.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | original idea.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ourtime.odt | 2024-05-18 18:12   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | outlines.odt | 2025-04-30 04:10   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | pain remade.odt | 2024-07-28 06:41   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | paul eons.odt | 2024-09-28 17:03   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | penn and teller once.odt | 2024-09-28 17:03   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | pit maneuvar.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | plasma chapter.odt | 2024-09-28 16:56   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | plasma earth.odt | 2024-07-04 00:51   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | plasma wids.odt | 2024-07-04 00:51   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | poems too.odt | 2024-07-28 06:41   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | poe shimmer.odt | 2025-04-30 04:10   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | policy.odt | 2024-09-28 17:03   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | polly chapter.odt | 2024-07-04 00:51   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | poly.odt | 2024-07-04 00:51   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | poly 2 outline.odt | 2024-07-04 00:51   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | poly chapter.odt | 2024-07-04 00:51   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | pope sees time.odt | 2024-09-28 17:03   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | pope travels tinme.odt | 2024-09-28 17:03   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | project 2025 policy implimentations.odt | 2024-07-28 06:41   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | prompts sd.odt | 2024-09-28 16:56   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | proposed outline.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/layout.gif)  | quantum-KASRIFv2.pdf | 2024-06-26 17:43   | 618K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | quantum baloney.odt | 2024-06-26 17:43   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | quantum epistomology.odt | 2024-06-26 17:43   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | quartaoins.odt | 2024-11-07 19:59   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | question to wolfram.odt | 2025-04-30 04:10   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | rabbit hole.odt | 2024-09-28 16:52   |  25K |   | 
![[   ]](/icons/unknown.gif)  | rabbit hole.rtf | 2024-09-28 16:52   |  14K |   | 
![[   ]](/icons/unknown.gif)  | rabbit hole seed.rtf | 2024-09-28 16:52   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | raw.odt | 2024-05-18 18:13   | 359K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | readability.odt | 2024-11-07 19:59   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | readers response to anthology.odt | 2024-06-26 17:43   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | relig.odt | 2024-06-26 17:43   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | resummme.odt | 2024-06-26 17:43   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | revelation 13.odt | 2024-09-28 16:56   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | rewritten death.odt | 2024-09-28 16:56   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | rewtww.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | river model knowell universe.odt | 2024-05-18 18:13   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | robot arms.odt | 2024-09-28 17:03   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | robot pyramids.odt | 2024-06-26 17:43   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sadfasdfasdf.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | saedf.odt | 2025-04-30 04:10   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | savant outline.odt | 2024-06-26 17:43   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | saving anthology.odt | 2024-09-28 17:03   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | schizophrenic savant.odt | 2024-09-28 16:56   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | science anarchy.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | scientist philosopher theologian.odt | 2024-05-18 18:13   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sdfasdfasf.odt | 2025-04-30 04:10   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sdfsafggh.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | seven sections.odt | 2025-04-30 04:10   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sfadfjhjkgk.odt | 2024-09-28 17:03   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sfffffdsx.odt | 2024-09-28 16:56   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sliver outline.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | so good2.odt | 2024-09-28 17:03   |  23K |   | 
![[   ]](/icons/layout.gif)  | solving-mathematical-problems-terence-tao.pdf | 2024-06-26 17:43   | 1.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sophia knowell.odt | 2024-06-26 17:43   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | spoonfull chaptgpt llama-3.odt | 2024-05-18 18:13   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | spoonfulls of nirvana two.odt | 2024-05-18 18:13   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ssi job.odt | 2024-06-26 17:43   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ssi job app.odt | 2024-06-26 17:43   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | stapp letter.odt | 2024-05-18 18:13   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | struggles.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | stylized and likely newly coined.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | subaru case number.odt | 2024-09-28 17:03   | 9.7K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sublimating their minds with Torus Knots.odt | 2025-04-30 04:10   |  66K |   | 
![[TXT]](/icons/text.gif)  | suggestions.txt | 2024-06-26 17:43   | 3.1K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | summary intro anth.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sunsetting.odt | 2024-06-26 17:43   |  54K |   | 
![[TXT]](/icons/text.gif)  | tactiq-free-transcript-SVS3-NDUC0M.txt | 2024-05-18 18:13   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tbfh.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tbfhell.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ted talk.odt | 2024-05-18 18:13   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ternary infinity.odt | 2024-07-28 06:41   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tesla knowell.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tesla stuff.odt | 2024-09-28 16:56   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test.odt | 2024-11-07 19:59   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test 1.odt | 2024-11-07 19:59   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test 2.odt | 2024-11-07 19:59   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test 3.odt | 2024-11-07 19:59   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | thank you letter to kim.odt | 2024-05-18 18:13   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | that will solidify.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/layout.gif)  | the-universe-in-cons-s6.pdf | 2024-06-26 17:43   | 659K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Akashic field.odt | 2025-04-30 04:10   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Great Depression foods.odt | 2025-04-30 04:10   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the KnoWellian Axiom.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the KnoWellian Universe Theory is a highly unique synthesis.odt | 2025-04-30 04:10   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Musk Trump revolution.odt | 2025-04-30 04:10   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the b from hell.odt | 2024-09-28 16:56   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the bitch from hell 2.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the francis letter.odt | 2024-09-28 17:03   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the graphical knowell.odt | 2024-09-28 16:56   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the heisenberg texts.odt | 2024-05-18 18:13   |  98K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the  immaculate seed.odt | 2024-09-28 17:03   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the interview.odt | 2024-06-26 17:43   |  68K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the interview final.odt | 2024-06-26 17:43   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the interview outline.odt | 2024-06-26 17:43   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the kw.odt | 2024-06-26 17:43   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the movie.odt | 2024-06-26 17:43   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the nolle hollogram.odt | 2024-09-28 17:03   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the pope time travels.odt | 2024-09-28 17:03   | 354K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the speed of light tested.odt | 2024-09-28 16:56   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the spoonful of nirvana.odt | 2024-05-18 18:33   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the tavern.odt | 2024-11-07 19:59   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | this could be.odt | 2024-05-18 18:13   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | three phase brain.odt | 2024-07-04 00:51   |  93K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | titled 1.odt | 2025-04-30 04:10   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | titled 2.odt | 2024-09-28 16:56   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tjhgfdsd.odt | 2025-04-30 04:10   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tled 3.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/layout.gif)  | transcendance-jcnv4i3_Kastrup.pdf | 2024-06-26 17:43   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | treytyre.odt | 2025-04-30 04:10   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tryuiolkjhg.odt | 2025-04-30 04:10   |  43K |   | 
![[   ]](/icons/unknown.gif)  | two-paths-to-intelligence.rtf | 2024-09-28 16:56   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tyuiotyui.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tz A Loving Shimmer of Hatefulness.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | up and down.odt | 2024-11-07 19:59   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | uytrdfghjtr.odt | 2025-04-30 04:10   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | vales chapter.odt | 2024-07-04 00:51   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | wave explained.odt | 2024-07-28 06:41   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | wes roth.odt | 2024-09-28 16:56   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | who is david noel lynch.odt | 2024-05-18 18:13   |  39K |   | 
![[   ]](/icons/layout.gif)  | why_materialism_is_baloney.pdf | 2024-06-26 17:43   | 2.0M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | why materilism in baloney.odt | 2024-06-26 17:43   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | world peace.odt | 2025-04-30 04:10   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | written by David Noel Lynch.odt | 2024-11-07 19:59   |  18K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | xAi Review of.odt | 2025-04-30 04:10   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yes the illusion.odt | 2024-09-28 16:56   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yiuiyutry.odt | 2025-04-30 04:10   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | youtube post.odt | 2024-09-28 16:56   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ytrreyrye.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ytuigfrtyui.odt | 2025-04-30 04:10   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ytuurt.odt | 2025-04-30 04:10   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yuityi.odt | 2025-04-30 04:10   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yutuhjnredh.odt | 2025-04-30 04:10   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | zombies.odt | 2024-09-28 16:56   |  43K |   | 
   
  |