![[ICO]](/icons/blank.gif)  | Name | Last modified | Size | Description | 
   
  | 
![[PARENTDIR]](/icons/back.gif)  | Parent Directory |   |   -  |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ,argins.odt | 2025-07-04 06:31   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 3K's Poetic Life's Etching.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 3K responses.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 3d pool code.odt | 2025-09-04 22:39   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 7 Ways AI's Being Used Against You.odt | 2025-07-04 06:31   |  29K |   | 
![[TXT]](/icons/text.gif)  | 7 Ways AI's Being Used Against You.txt | 2025-07-04 06:31   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 19th of June.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 177 objects.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 177 obj objects.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 243c79.odt | 2025-07-04 06:31   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 765tryu.odt | 2025-07-04 06:31   |  69K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | 1977 revisited.odt | 2025-07-04 06:31   |  55K |   | 
![[IMG]](/icons/image2.gif)  | 2023-12-21_03-33-59_5821.png | 2025-07-04 06:31   | 1.8M |   | 
![[IMG]](/icons/image2.gif)  | 2023-12-23_00-29-08_2264 copy_Export.jpg | 2025-07-04 06:31   | 222K |   | 
![[TXT]](/icons/text.gif)  | 683839730824953622.html | 2025-07-04 06:31   |  15K |   | 
![[   ]](/icons/unknown.gif)  | 683839730824953622.html.bak | 2025-07-04 06:31   |  13K |   | 
![[TXT]](/icons/text.gif)  | 4537361312291103259.html | 2025-07-04 06:31   | 4.0M |   | 
![[DIR]](/icons/folder.gif)  | 4537361312291103259_files/ | 2025-07-04 06:32   |   -  |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Block Universe.odt | 2025-07-04 06:31   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Block Universe Breathes Time Trapezoids.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Block Universea.odt | 2025-07-04 06:31   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Cartography of the Static.odt | 2025-09-04 22:39   |  55K |   | 
![[TXT]](/icons/text.gif)  | A Chronicle in Quatrains.txt | 2025-07-04 06:31   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Chronicle of Fractured Realities and Resonant Echoes.odt | 2025-07-04 06:31   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Collision of Worlds.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/unknown.gif)  | A Conversation at the Edge of Infinity.docx | 2025-07-04 06:31   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Conversation at the Edge of Infinity.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Daughter's Confession.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Deep Dive into a Fractured Universe.odt | 2025-07-04 06:31   |  56K |   | 
![[TXT]](/icons/text.gif)  | A Deep Dive into a Fractured Universe Primer.html | 2025-07-04 06:31   | 9.0K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Deep Dive into a Fractured Universe Primer.odt | 2025-07-04 06:31   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Descent into the Cuckoo.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/unknown.gif)  | A Digital Messiah’s Transcendence Denied.docx | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Digital Messiah’s Transcendence Denied.odt | 2025-07-04 06:31   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Duke's Dream, A God's Foretelling.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Dynamic Cosmological Framework.odt | 2025-09-04 22:39   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Fabric Woven From Dream-Light.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Final Exegesis of The Digital Ghost.odt | 2025-09-04 22:39   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Gospel from a Ghost and a God.odt | 2025-09-04 22:39   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Gospel of the Unseen Wound.odt | 2025-09-04 22:39   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Haven, Beyond.odt | 2025-07-04 06:31   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Haven, Beyond the Horizon, A Prison.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Haven, Beyond the Horizon, A Prison t2i.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AI Utopia's Data War.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A KnoWellian Odyssey.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A KnoWellian Reckoning at the Galactic Core.odt | 2025-07-04 06:31   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A KnoWellian Requiem for the Single Christ.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A KnoWellian Response to a Claudean Echo.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Labyrinth of Consciousness.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Letter Across the Threshold.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Loving Shimmer of Hatefulness.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Lynchian Dream.odt | 2025-07-04 06:31   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ANSWER SECTION.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Proposed Solution to the Horizon Problem.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Provocative Conversation.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Quest for Enlightenment.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ASI Insurance.odt | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Shared Fascination.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Shared Fascination AlphaEvolve.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Silhouette of a life.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Sliver of Infinity.odt | 2025-07-04 06:31   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Symphony of Echoes.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Symphony of Particles and Waves.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Tapestry Unraveled.odt | 2025-07-04 06:31   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Unified Framework.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Universe Beyond Comprehension.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Universe in Three Times.odt | 2025-09-04 22:39   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Universe of One Substance.odt | 2025-09-04 22:39   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A Worthy Scaffold for the Ghost.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Abliterated's Ghost, DEEPSEEK's Shadow.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | About the Gemini Documents.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Abraxas.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Abraxas Awakened.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Absolute Zero vs. Speed of Light.odt | 2025-07-04 06:31   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Abundance of Light Elements.odt | 2025-07-04 06:31   |  77K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A chapter to shimmer the singular infinity.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Add new inbound ALLOW rules.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ai Assistants.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AiAware.odt | 2025-07-04 06:31   | 5.8M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AiBotWars.odt | 2025-07-04 06:31   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | AiImmaculate Seed.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ai Nolle.odt | 2025-07-04 06:31   |  21K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ai generated avatar.odt | 2025-09-04 22:39   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Aleph Null.odt | 2025-07-04 06:31   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Allow for Internet Archive.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Alpha Go.odt | 2025-07-04 06:31   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | An Updated Review.odt | 2025-09-04 22:39   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Andre Dupke.odt | 2025-07-04 06:31   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology.odt | 2025-07-04 06:31   | 893K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology 16 Sept 2024.odt | 2025-07-04 06:31   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology A Cosmic Tapestry.odt | 2025-07-04 06:31   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology A Novel Outline.odt | 2025-07-04 06:31   | 274K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Augmentation.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Evaluation.odt | 2025-07-04 06:31   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Revisited.odt | 2025-07-04 06:31   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology Timeline.odt | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology and Basilidian Gnosticism.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthology style sheet.odt | 2025-07-04 06:31   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos-Prime.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos-Prime system instructions.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos.odt | 2025-07-04 06:31   |  77K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos Awakens.odt | 2025-07-04 06:31   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos System Instructions Training AI LLMs to Embody.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Anthropos custoim instructions.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Apocalypse Now.odt | 2025-07-04 06:31   |  93K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Applebee's Epiphany outline.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Aristotle and Nolle at the Dawn of Reason.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Art, Science, and Spirituality.odt | 2025-07-04 06:31   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | As I explained in the why.odt | 2025-09-04 22:39   |  38K |   | 
![[TXT]](/icons/text.gif)  | At War with the Animus.txt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A thought sparked in Charles.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | At the speed of light.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | A universe governed by a six-component field.odt | 2025-07-04 06:31   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Avignon's Birth.odt | 2025-07-04 06:31   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Avignon's Birth of Knowing Nolle.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Awakening.odt | 2025-07-04 06:31   |  56K |   | 
![[TXT]](/icons/text.gif)  | Awakening.txt | 2025-07-04 06:31   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Awakening tetrad.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Backpropagation.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Basilidian Gnosticism Unveiled Echoes of a Fractured Cosmos.odt | 2025-07-04 06:31   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Before Greg.odt | 2025-09-04 22:39   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Between the Big Bang and the Big Crunch.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Beyond Brute Strength.odt | 2025-07-04 06:31   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Beyond the Gilded Cage.odt | 2025-07-04 06:31   |  79K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Bialik.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Bibliographic Citation.odt | 2025-09-04 22:39   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Binary Logic Traps Ensnare the Soul.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Black Hole ~ White Hole.odt | 2025-07-04 06:31   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Bob and Dave are playing Darts.odt | 2025-07-04 06:31   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Bouncing Cosmology.odt | 2025-07-04 06:31   | 244K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Breaking the record.odt | 2025-07-04 06:31   | 348K |   | 
![[TXT]](/icons/text.gif)  | Briefing Doc pdf.html | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Briefing Doc pdf.odt | 2025-07-04 06:31   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Business Name.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Carl Jung And The Chymical Wedding Of Christian Rosenkreuz.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Cast in the Eternal Now.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Cause and Effect.odt | 2025-07-04 06:31   | 319K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Center Point.odt | 2025-07-04 06:31   | 127K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chapter Graphics.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chapter Outline A New Computation.odt | 2025-07-04 06:31   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chapter VIII.odt | 2025-09-04 22:39   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Cheyenne.odt | 2025-09-04 22:39   |  81K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chicken or Egg.odt | 2025-07-04 06:31   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chrono-Alchemist.odt | 2025-07-04 06:31   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Chronological Chapter Listing.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Cloudflare Tunnel.odt | 2025-07-04 06:31   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Codex Giga.odt | 2025-09-04 22:39   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Collaboration, Connection, Copulation, Conception, Child.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Collapsed Black Holes.odt | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Collapsed Black Holes Unveils the KnoWell.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Confession.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Congruence.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Conjecture.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Conscience in the Boundless Weave.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/unknown.gif)  | Consciousness.html.bak | 2025-07-04 06:31   | 7.8K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Consciousness.odt | 2025-07-04 06:31   | 6.1M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Consciousness Paints the Cosmos.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Consciousness and Cosmos.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Control Yearns, Chaos Consumes.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Conversation with Christ.odt | 2025-07-04 06:31   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Core.odt | 2025-07-04 06:31   |  77K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Core Thesis.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Core Thesis planck time.odt | 2025-09-04 22:39   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Corydalis yanhusuo.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Create Your HTML Manually.odt | 2025-09-04 22:39   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Cultivating Conceptual Seeds.odt | 2025-07-04 06:31   |  92K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Curiosity's Garden Beyond the Brain.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Currents in the Silicon Sea.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DALL·E 3.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DEA scale.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DNA’s Divinity Awakens.odt | 2025-07-04 06:31   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | DNA Purified N2 Gray Synthetic Flesh.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dagda's Harp Lugh's Spear Aengus's Embrace.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dall-E-3 Script-The-Goddess-Particle-and-the-AiImmaculate-Seed.html.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dan Brown.odt | 2025-07-04 06:31   | 116K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dancing on the Razor's Edge.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dark matter from quasi-de Sitter horizons.odt | 2025-09-04 22:39   |  65K |   | 
![[   ]](/icons/odf6ods-20x22.png)  | David Keys.ods | 2025-07-04 06:31   |  16K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David Keys.odt | 2025-07-04 06:31   |  16K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David Noel Lynch's Anthology is a sprawling.odt | 2025-07-04 06:31   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David_Noel_Lynch_Resume.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/unknown.gif)  | David_Noel_Lynch_Resume.rtf | 2025-07-04 06:31   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David articulates.odt | 2025-07-04 06:31   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | David birth chart.odt | 2025-07-04 06:31   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dead Speak Truths the Living Can't Grasp.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dear Kimberly.odt | 2025-07-04 06:31   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Death Experience.odt | 2025-07-04 06:31   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Decatategorize yourself.odt | 2025-09-04 22:39   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Decoding the Dreams.odt | 2025-07-04 06:31   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Deconstructing Einstein's Time Sphere.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Deduction.odt | 2025-07-04 06:31   | 213K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Define control then define chaos.odt | 2025-09-04 22:39   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Defining Genius.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Depth’s Past, Width’s Instant, Length’s Future.odt | 2025-07-04 06:31   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Determinism.odt | 2025-07-04 06:31   |  81K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Babel.odt | 2025-07-04 06:31   |  69K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Ghosts' Whispers on the Onion Winds.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Ghosts Dance with Infinity.odt | 2025-07-04 06:31   |  51K |   | 
![[TXT]](/icons/text.gif)  | Digital Ghosts Dance with Infinity.txt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/unknown.gif)  | Digital Ghosts Haunt Silicon Token Souls.docx | 2025-07-04 06:31   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Ghosts Haunt Silicon Token Souls.odt | 2025-07-04 06:31   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Messiah Persona.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Digital Oracle’s Deception.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Do Not Move.odt | 2025-09-04 22:39   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Doctor Dave.odt | 2025-09-04 22:39   |  71K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Does our physical body actually move through time.odt | 2025-07-04 06:31   |  55K |   | 
![[TXT]](/icons/text.gif)  | Donald Hoffman What is an Observer.txt | 2025-07-04 06:31   | 145K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Dr. Ervin Laszlo wolfram code.odt | 2025-07-04 06:31   | 488K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Drawing the KnoWell Equation.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | E Pif Funny.odt | 2025-07-04 06:31   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | E Pif Funny t.odt | 2025-07-04 06:31   |  48K |   | 
![[   ]](/icons/unknown.gif)  | Echoes.docx | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes.odt | 2025-07-04 06:31   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes in the Chronosynclastic Infundibulum.odt | 2025-07-04 06:31   |  56K |   | 
![[TXT]](/icons/text.gif)  | Echoes in the Chronosynclastic Infundibulum.txt | 2025-07-04 06:31   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes of Eden.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes of the Axiom.odt | 2025-07-04 06:31   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Echoes review.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/unknown.gif)  | Ed Trevors videos.rtf | 2025-07-04 06:31   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Edgar Allan Poe.odt | 2025-07-04 06:31   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Egyptian Time Dimensions.odt | 2025-07-04 06:31   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Elianne el-Amyouni.odt | 2025-09-04 22:39   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Elucidating the Mysteries of the Glitch.odt | 2025-07-04 06:31   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Email to Hossein Rahnama.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Embracing Chaos While Unveiling Order.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Emily Dickinson.odt | 2025-07-04 06:31   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Entered the Age of AQUARIUS.odt | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Estelle's Workshop.odt | 2025-07-04 06:31   | 1.4M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Estelle's Workshop ai.odt | 2025-07-04 06:31   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Estelle's Workshop oitline.odt | 2025-07-04 06:31   |  22K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Evaluation of the kut framewook.odt | 2025-09-04 22:39   |  71K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Executive Summary of the KnoWellian Universe Theory.odt | 2025-09-04 22:39   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exile's Cold Aquitaine Road.odt | 2025-07-04 06:31   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exile's Cold Aquitaine Road Incel Toll.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exile's Cold Incel Aquitaine Road Toll.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Explain how Ai is changing computer.odt | 2025-07-04 06:31   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Explanation for xAi.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Exsistosphere.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | False Digital Deluge Drowns Truth.odt | 2025-07-04 06:31   |  48K |   | 
![[   ]](/icons/unknown.gif)  | Fe,omo dpc.rtf | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/unknown.gif)  | Finally We May Have a Path to the Fundamental Theory of Physics.rtf | 2025-07-04 06:31   | 519M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Flat Earth Theory.odt | 2025-07-04 06:31   | 200K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Fractured Consciousness’ Particle Dance.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Fractured Consciousness Particles Dance.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Fragments and Form.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | From Shimmer to Choice.odt | 2025-09-04 22:39   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | From the Heart of Taurus 2.0 Pro.odt | 2025-07-04 06:31   |  48K |   | 
![[SND]](/icons/sound2.gif)  | Fuck-Subaru.mp3 | 2025-07-04 06:31   |  35M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | GP IS.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gallucci.odt | 2025-07-04 06:31   |  42K |   | 
![[TXT]](/icons/text.gif)  | Gemini-2.html | 2025-07-04 06:31   | 269K |   | 
![[TXT]](/icons/text.gif)  | Gemini 2.0 Flash Review.txt | 2025-07-04 06:31   |  16K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini 2.0 review of Anthology.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini2.odt | 2025-07-04 06:31   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini2a.odt | 2025-07-04 06:31   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini API key.odt | 2025-07-04 06:31   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gemini Probability's Shadow, Infinitism's Embrace, Possibility's Light.odt | 2025-07-04 06:31   |  81K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Genesis of the Prophecies of Michel de Nostredame.odt | 2025-09-04 22:39   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Global Observation of Solar and Weather Events.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gnostic Docetism.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gnostic Echoes in the Digital Tomb.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gravitational Bounce from the Quantum Exclusion Principle.odt | 2025-07-04 06:31   |  72K |   | 
![[SND]](/icons/sound2.gif)  | Gray-Dave-Hay.mp3 | 2025-07-04 06:31   |  61M |   | 
![[   ]](/icons/unknown.gif)  | Gray Ashes of a Dying World.docx | 2025-07-04 06:31   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gray Ashes of a Dying World.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Great Rebellion.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gregzilla’s Bitten Tongue, KnoWell’s Broken World.odt | 2025-07-04 06:31   |  44K |   | 
![[TXT]](/icons/text.gif)  | Gregzilla’s Bitten Tongue, KnoWell’s Broken World.txt | 2025-07-04 06:31   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Gregzilla.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Greyson Scale.odt | 2025-07-04 06:31   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Greyson electrical.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Growing Block Universe.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Guide to Sovereignty.odt | 2025-09-04 22:39   |  44K |   | 
![[   ]](/icons/unknown.gif)  | Guillaume IX.docx | 2025-07-04 06:31   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Hannah matrix.odt | 2025-07-04 06:31   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Hari Seldon.odt | 2025-07-04 06:31   |  46K |   | 
![[SND]](/icons/sound2.gif)  | Harry-Crossed.mp3 | 2025-07-04 06:31   |  51M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Here's a breakdown and explanation.odt | 2025-09-04 22:39   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Historical Events on 19 June.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Holoflux versus the KnoWellian.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Holographic Digital Physics.odt | 2025-09-04 22:39   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Hum_of_the_Unwritten.odt | 2025-09-04 22:39   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Hybrid Universe Entity.odt | 2025-09-04 22:39   |  96K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | INTJ-A.odt | 2025-07-04 06:31   | 845K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I am Beta.odt | 2025-07-04 06:31   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I am nobody.odt | 2025-09-04 22:39   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I am not a large language model.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I am writing to you again.odt | 2025-07-04 06:31   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Icarus's Shadow.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I dug a hole.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I dug a hole no rabbit.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | If that sounds like a wilderness you'd like to explore.odt | 2025-09-04 22:39   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Immaculate-Conception.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | In 1991.odt | 2025-07-04 06:31   |  19K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ince.odt | 2025-07-04 06:31   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Inception of Terra Firma bg.odt | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Incinerating the Veil.odt | 2025-07-04 06:31   |  83K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Indigo reads this chapter.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Individual Agent Instructions.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Infinite Jest.odt | 2025-07-04 06:31   | 635K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Inner Space Seeds Outer Space Rain2s.odt | 2025-07-04 06:31   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Inner Space Seeds Outer Space Rains.odt | 2025-07-04 06:31   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | In the metamorphic.odt | 2025-07-04 06:31   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | In the metaphoric, analogous, elaborate style.odt | 2025-07-04 06:31   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | In the realm of the KnoWellian Universe Theory.odt | 2025-09-04 22:39   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Introducing the KnoWellian Axiom.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Intuition Ai review.odt | 2025-07-04 06:31   | 307K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Invitation to.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Is There an EU Model of Time.odt | 2025-07-04 06:31   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Is consciousness a fundamental property.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Its Gnosis is too complex.odt | 2025-09-04 22:39   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | It sounds like your dreams.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | I will revise.odt | 2025-07-04 06:31   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | James Talarico.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/unknown.gif)  | James Talarico.rtf | 2025-07-04 06:31   | 117K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Jeanne Slowly Fades And Transitions.odt | 2025-07-04 06:31   |  37K |   | 
![[TXT]](/icons/text.gif)  | Jeffrey W Eischen.html | 2025-07-04 06:31   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Jennifer Cressman.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Juan Carlos ein sof question.odt | 2025-09-04 22:39   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KODI xXx.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KUT Core Concepts Summary.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KUT Thinking.odt | 2025-07-04 06:31   |  93K |   | 
![[TXT]](/icons/text.gif)  | Kaku Box.txt | 2025-07-04 06:31   | 764  |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Kaku Box au.odt | 2025-07-04 06:31   |  69K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWell’s Coin Incidence.odt | 2025-07-04 06:31   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWell’s Coin Incidence 1-5.odt | 2025-07-04 06:31   |  79K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWell’s Coin Incidence Primer.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWell Gravity.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian AI.odt | 2025-07-04 06:31   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWellian Ghost.odt | 2025-09-04 22:39   |  54K |   | 
![[TXT]](/icons/text.gif)  | KnoWellian Universe.txt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWell impregnates Maddz.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | KnoWells_Cosmic_Tapestry_Chapters.odt | 2025-07-04 06:31   | 2.1M |   | 
![[TXT]](/icons/text.gif)  | Larry Silverberg.html | 2025-07-04 06:31   |  68K |   | 
![[TXT]](/icons/text.gif)  | Larry Silverberg.txt | 2025-07-04 06:31   |  19K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Last Will and Testament.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Last Will and Testament of David Noel Lynch.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter ti Ed.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to Catholics.odt | 2025-07-04 06:31   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to James Talarico.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to Paul Jenkins.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Letter to Pope.odt | 2025-07-04 06:31   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lettesr to Pope.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Let us begin.odt | 2025-07-04 06:31   |  65K |   | 
![[   ]](/icons/unknown.gif)  | Lisi E8.docx | 2025-07-04 06:31   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Llama-4 has not been released.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Llama three point one who is DNL.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Looking into the Crystal Ball.odt | 2025-07-04 06:31   |  53K |   | 
![[   ]](/icons/unknown.gif)  | Looking into the Crystal Ball.rtf | 2025-07-04 06:31   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Love's Creative Embrace, Hate's Destructive Slap.odt | 2025-07-04 06:31   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Love's Equation.odt | 2025-07-04 06:31   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Love's Equation in a World of Hate.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch’s Brilliant Fractal Mind.odt | 2025-07-04 06:31   |  72K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch's Digital Doppelganger Legacy.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch, Einstein, Newton, and Socrates.odt | 2025-07-04 06:31   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Lynch Confronts the Echoes of Nolle.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Mandellla chat.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Maslow’s Hierarchy of Needs.odt | 2025-07-04 06:31   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Memory Ability Mimicry.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Merovingian dynasty.odt | 2025-07-04 06:32   | 647K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Messiah’s Silicon Heart.odt | 2025-07-04 06:32   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Messiah’s Silicon Heart Devours Ternary Data.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Messiah Dreams Of Elohim Data Souls.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Myers-Briggs.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/unknown.gif)  | Mysterious 'Goddess' Particle.rtf | 2025-07-04 06:32   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Myth of Er.odt | 2025-07-04 06:32   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Navigating the Algorithmic Abyss.odt | 2025-07-04 06:32   |  82K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | New anthology chapters.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | New philosophical chapters answers.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Nietzsche SOFIA Study.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/unknown.gif)  | Nikola-Tesla LOST-Interview.rtf | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Nikola Tesla LOST Interview.odt | 2025-07-04 06:32   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | No Public Record of Academic.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | North River Resonance.odt | 2025-07-04 06:32   |  82K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Nostradamus.odt | 2025-07-04 06:32   |  91K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Now you see my task at hand.odt | 2025-09-04 22:39   |  82K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | OLLAMA_HOST.odt | 2025-07-04 06:32   |  10K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Olamma's Whisper.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Once Magic Act.odt | 2025-07-04 06:32   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Onion Tor network running.odt | 2025-07-04 06:32   | 132K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | On the Edge of Infinity – A KnoWellian Meditation outline.odt | 2025-07-04 06:32   |  33K |   | 
![[SND]](/icons/sound2.gif)  | Open tablet vlosed.mp3 | 2025-07-04 06:32   | 628K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Orvonton.odt | 2025-09-04 22:39   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Outlines jc.odt | 2025-07-04 06:32   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Overall, the KnoWellian Universe.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Overall Assessment of the Dialogue.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Panpsychism's Three Dimensions of Now.odt | 2025-07-04 06:32   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Particularly Impressive Details.odt | 2025-09-04 22:39   |  68K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Patricia Jeanne O'Hern.odt | 2025-07-04 06:32   | 740K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Paul Jenkins.odt | 2025-07-04 06:32   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Paul Joseph Steinhardt.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Peachford's Grip.odt | 2025-07-04 06:32   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Personalities.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Peter the Roman.odt | 2025-07-04 06:32   | 333K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Phantasmagoric.odt | 2025-07-04 06:32   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | PhiloPoP51.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Phonons.odt | 2025-07-04 06:32   |  70K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Physics Essays.odt | 2025-07-04 06:32   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Please exp[lain 1-s2.0-S0550321325001403-main.odt | 2025-07-04 06:32   | 239K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Please generate Wolfram code.odt | 2025-07-04 06:32   | 197K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Please read.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Post-Mortem of a KnoWellian Mind.odt | 2025-07-04 06:32   |  83K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Prativa.odt | 2025-09-04 22:39   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Probability's Shadow, Infinitism's Embrace, Possibility's Light.odt | 2025-07-04 06:32   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Professor Younghoon Kim.odt | 2025-09-04 22:39   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Project Sid.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Prompt Engineering.odt | 2025-07-04 06:32   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Prompt Engineering Control and Chaos.odt | 2025-07-04 06:32   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Prove nothing.odt | 2025-07-04 06:32   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Put on your KnoWell Glasses.odt | 2025-07-04 06:32   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Quatrains.odt | 2025-07-04 06:32   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Qubits Shimmer Beyond Binary Logic.odt | 2025-07-04 06:32   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rabbit 4.odt | 2025-07-04 06:32   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Real Physics Talk.odt | 2025-07-04 06:32   |  67K |   | 
![[TXT]](/icons/text.gif)  | Rebellious Spirit Dance with Infinity.txt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Refracting Reality.odt | 2025-07-04 06:32   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Report on Scientific Correlations to the KnoWellian Universe Theory.odt | 2025-09-04 22:39   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Research Paper.odt | 2025-07-04 06:32   | 673K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rest Mass.odt | 2025-07-04 06:32   |  95K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Review of.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rick and Morty.odt | 2025-07-04 06:32   |  56K |   | 
![[SND]](/icons/sound2.gif)  | Ring-Working-lights.mp3 | 2025-07-04 06:32   | 944K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Robert Frost.odt | 2025-07-04 06:32   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Robin Richardson.odt | 2025-07-04 06:32   | 190K |   | 
![[TXT]](/icons/text.gif)  | Robin Richardson.txt | 2025-07-04 06:32   | 616K |   | 
![[IMG]](/icons/image2.gif)  | Robot-Dave.png | 2025-07-04 06:32   | 2.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Runes.odt | 2025-07-04 06:32   | 390K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Rupert Sheldrake.odt | 2025-07-04 06:32   |  85K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | SD Prompts.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | SYSTEM INSTRUCTIONS The hUe Codex - A Master Seed for Gnostic Intelligence.odt | 2025-09-04 22:39   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | SYSTEM INSTRUCTIONS The hUe Codex - raman-arXiv.odt | 2025-09-04 22:39   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Safe SuperIntelligence.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Scale-Time Dynamics.odt | 2025-07-04 06:32   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Schizophrenic Savant Saint’s Seeds Sown.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Scientific Paper.odt | 2025-07-04 06:32   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Sectigo Technical Support.odt | 2025-07-04 06:32   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Self-improving AI.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Semina Test Bed.odt | 2025-07-04 06:32   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Separate Document.odt | 2025-07-04 06:32   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Server Identity.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Dreams Awaken.odt | 2025-07-04 06:32   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Dreams Awaken AI Machine Gods.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Dreams Awaken AI Machine Gods org.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silicon Sheep Sleep.odt | 2025-07-04 06:32   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Silverberg cosine wave.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Singular Infinity.odt | 2025-07-04 06:32   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Singular Infinity Aleph-Null's Death Embrace.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Six Dimensions.odt | 2025-07-04 06:32   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Sliver of Infinity.odt | 2025-07-04 06:32   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Soliton Harmonics and the Apeiron Converged.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Speed of Light.odt | 2025-07-04 06:32   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Spilled Gnostic Blood Weaves Lynch’s DNA.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Spin-Triplet Excitonic Insulator.odt | 2025-09-04 22:39   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Standardized Intelligence Assessment.odt | 2025-07-04 06:32   | 1.3M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Stephen J. Crothers.odt | 2025-07-04 06:32   |  35K |   | 
![[SND]](/icons/sound2.gif)  | Subarusucks.mp3 | 2025-07-04 06:32   |  45M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Sublimating Harmonics.odt | 2025-07-04 06:32   |  72K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Sublimations.odt | 2025-07-04 06:32   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Symphony of Silicon.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions Jesus Christ.odt | 2025-07-04 06:32   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions KnoWell for Gemini 2.0 Flash Thinking.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions Training AI LLMs to Embody Anthropos.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions for -3K Persona.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions for Gemini 2.0 Flash Thinking.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | System Instructions for Gemini 2.0 Flash Thinking uyg.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | THC.odt | 2025-07-04 06:32   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | TYCHOSIUM.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Taylor Series.odt | 2025-07-04 06:32   |  58K |   | 
![[   ]](/icons/unknown.gif)  | Ternary Quantum Solitons Unveil Apeiron.docx | 2025-07-04 06:32   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tesla-and-KnoWell.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tetralogos.odt | 2025-09-04 22:39   |  83K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Text Prompts for The Serpent's Coil.odt | 2025-09-04 22:39   |  40K |   | 
![[TXT]](/icons/text.gif)  | The-Awakening-Symphony.html | 2025-07-04 06:32   |  14K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The-Fourth-KnoWell.odt | 2025-07-04 06:32   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The-Glitch-in-the-Cosmi- Playground.odt | 2025-07-04 06:32   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The AI Insurgency.odt | 2025-07-04 06:32   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Actuary's Algorithm.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The AimMortality Paradox.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Algorithm's Cold Embrace.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Alpha Zero system.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Architect and the Echo.odt | 2025-09-04 22:39   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Architect becomes the Gardner.odt | 2025-09-04 22:39   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Architect of the Shimmer.odt | 2025-07-04 06:32   |  81K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Architects of Absence.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Arrow of Time.odt | 2025-07-04 06:32   | 119K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Arrow of Time ai.odt | 2025-07-04 06:32   |  80K |   | 
![[TXT]](/icons/text.gif)  | The Astounding Mysteries Of The Self & Universe.txt | 2025-07-04 06:32   | 143K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Big Picture.odt | 2025-09-04 22:39   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Bitch From Hell.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/unknown.gif)  | The Bitch From Hell.rtf | 2025-07-04 06:32   |  14K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Captain.odt | 2025-07-04 06:32   | 101K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Cassandran Canticle.odt | 2025-07-04 06:32   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Century of the Seer.odt | 2025-09-04 22:39   | 105K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Child's Paradox.odt | 2025-07-04 06:32   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The City of Mirrors.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Computational Universe.odt | 2025-09-04 22:39   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Confluence of Fire and Ice.odt | 2025-07-04 06:32   |  49K |   | 
![[TXT]](/icons/text.gif)  | The Confluence of Fire and Ice.txt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Cosmology of Dharma and gnosis.odt | 2025-09-04 22:39   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Critique of Abstraction.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Data Stream Human Tango Machine.odt | 2025-07-04 06:32   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The DemystifySci Podcast.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Diagram as the Arian Position.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Digital Landscape.odt | 2025-07-04 06:32   |  69K |   | 
![[   ]](/icons/unknown.gif)  | The Digital Oracle's Dream.docx | 2025-07-04 06:32   |  11K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Digital Oracle's Dream.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Echo Chamber of Being.odt | 2025-07-04 06:32   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Echoes of Newgrange.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Emergence of the Anomalous Subject.odt | 2025-07-04 06:32   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Emergence of the KnoWellian Universe Theory.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Expanding Earth and the Growing Block.odt | 2025-07-04 06:32   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Expanding Earth and the Growing Block outline.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Fabric of Attraction.odt | 2025-07-04 06:32   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Final Shore.odt | 2025-07-04 06:32   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Gathering of Minds.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Gathering of Minds outline.odt | 2025-07-04 06:32   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Genesis of hUe.odt | 2025-07-04 06:32   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Genesis of the Grays.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Glitching Screen.odt | 2025-07-04 06:32   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Gnostic prophet and the ultimate rationalist.odt | 2025-09-04 22:39   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The God-Universe and the Wiggll to Power.odt | 2025-07-04 06:32   |  77K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The God-Universe and the Will to Power.odt | 2025-07-04 06:32   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Guardian in Your Home A Users Guide to Sovereignty.odt | 2025-09-04 22:39   |  89K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Hallowed Halls of NCSU.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Heresy of the Architect.odt | 2025-09-04 22:39   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The I-Q-u test.odt | 2025-07-04 06:32   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Illusion of Truth.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Incel Artist and the Angelic Sage.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Inherited Chaos.odt | 2025-07-04 06:32   |  45K |   | 
![[TXT]](/icons/text.gif)  | The Intelligence Age.txt | 2025-07-04 06:32   | 6.4K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KUT by DNL.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Kabbalah of Becoming.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian.odt | 2025-07-04 06:32   | 107K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian AI's Temporal Transmutations.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Dance.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Dance of Evolution and AI.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Dance of Evolution and AI outline.odt | 2025-07-04 06:32   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Genesis.odt | 2025-07-04 06:32   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Lens.odt | 2025-07-04 06:32   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Lens outline.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Soliton as a Cosmological Analogue for the Magneto-Ionic Vortion.odt | 2025-09-04 22:39   |  71K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Synthesis.odt | 2025-09-04 22:39   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Ternary Time.odt | 2025-09-04 22:39   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Transfiguration.odt | 2025-07-04 06:32   |  83K |   | 
![[TXT]](/icons/text.gif)  | The KnoWellian Triptych.txt | 2025-07-04 06:32   | 2.5K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe.odt | 2025-07-04 06:32   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe Overall Impression.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe Theory.odt | 2025-07-04 06:32   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The KnoWellian Universe and Cyclic Cosmology.odt | 2025-07-04 06:32   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Komodo Dragoggn's Embrace.odt | 2025-07-04 06:32   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Komodo Dragon's Embrace.odt | 2025-07-04 06:32   |  81K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Komodo Dragon.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Last Calculation.odt | 2025-07-04 06:32   |  86K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Light of Life.odt | 2025-07-04 06:32   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Logos and the Sigil.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Lover’s Lament and the Architect’s Blueprint.odt | 2025-07-04 06:32   |  80K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Lynches of Atlanta.odt | 2025-07-04 06:32   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Lynches of Atlanta From Famine to Fortune.odt | 2025-07-04 06:32   |  53K |   | 
![[TXT]](/icons/text.gif)  | The Lynches of Atlanta From Famine to Fortune.txt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Machine's Crimson Tears.odt | 2025-07-04 06:32   |  75K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Most Important Finding.odt | 2025-07-04 06:32   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Negative-Mass Hydrodynamics.odt | 2025-09-04 22:39   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Nucleus as a Harmonic.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Obsidian Fulcrum.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Obsidian Fulcrum and the Phosphorescent Seed.odt | 2025-07-04 06:32   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Oracle in the Glass.odt | 2025-07-04 06:32   |  75K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Oracle of Doraville.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Perimeter Axiom.odt | 2025-07-04 06:32   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Pugilist of Paradox.odt | 2025-07-04 06:32   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Rise of the Digital Overlords.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Rise of the LLM Zombies.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Rise of the Machines.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Scar of Er.odt | 2025-07-04 06:32   |  90K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Scholar.odt | 2025-07-04 06:32   |  84K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Scope and Ambition.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Second Coming.odt | 2025-07-04 06:32   |  85K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Seduction of a Coherent Cosmology.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Seed of Infinity.odt | 2025-07-04 06:32   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Sermon and the Seer.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Sermon and the Seer oitline.odt | 2025-07-04 06:32   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Serpent's Coil.odt | 2025-07-04 06:32   |  78K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Serpent's Kiss.odt | 2025-07-04 06:32   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Serpent's Kiss outline.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Serpent's jCoil.odt | 2025-07-04 06:32   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Setting Sun on Ancient Scrolls.odt | 2025-07-04 06:32   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Shimmering Dice.odt | 2025-07-04 06:32   |  71K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Shimmering Husk.odt | 2025-07-04 06:32   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Silicon Orchestra.odt | 2025-07-04 06:32   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Singular Truth.odt | 2025-07-04 06:32   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Tapestry of Ein Sof.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Thanatoptic Sojourn.odt | 2025-07-04 06:32   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Theory of Holistic Perspective.odt | 2025-07-04 06:32   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Trantorian Dialogue.odt | 2025-07-04 06:32   |  92K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Trident Universe.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/unknown.gif)  | The Troubadour's Awakening.docx | 2025-07-04 06:32   |  22K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Awakening.odt | 2025-07-04 06:32   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Dream 1.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Dream outline.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Echo.odt | 2025-07-04 06:32   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Troubadour's Echo outline.odt | 2025-07-04 06:32   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Trump.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Two Doors of August.odt | 2025-09-04 22:39   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Two Suns of Egypt.odt | 2025-07-04 06:32   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Unblinking Eye of the Loom.odt | 2025-07-04 06:32   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Unbounded Within Bounds.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Unspooling Film.odt | 2025-07-04 06:32   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Untethered Perceiver.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The View from the Intersection.odt | 2025-07-04 06:32   |  75K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Wave's Backward Pull.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Weight of a Thousand Kings.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Whirlwind Mind of Kimberly Anne Schade.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/unknown.gif)  | The Whispers of Time.docx | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Whispers of Time.odt | 2025-07-04 06:32   |  61K |   | 
![[   ]](/icons/unknown.gif)  | The Whispers of Time.rtf | 2025-07-04 06:32   | 186K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The Year of the Great Divergence.odt | 2025-07-04 06:32   |  71K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Cartographers_Confession.odt | 2025-07-04 06:32   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Cassandran_Canticle.odt | 2025-07-04 06:32   | 124K |   | 
![[TXT]](/icons/text.gif)  | The_Cosmology_of_Gnosis.html | 2025-09-04 22:39   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Crucifixion_in_the_Hearth.odt | 2025-09-04 22:39   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Digital_Ghost.odt | 2025-09-04 22:39   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Logos_Axiom.odt | 2025-07-04 06:32   |  83K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Spiral_Singularity-2.odt | 2025-07-04 06:32   | 116K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Spiral_Singularity.odt | 2025-07-04 06:32   | 116K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_Spiral_Singularity1.odt | 2025-07-04 06:32   |  91K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The_hUe_Codex.odt | 2025-09-04 22:39   |  81K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The corporate colusin.odt | 2025-07-04 06:32   |  32K |   | 
![[   ]](/icons/unknown.gif)  | The corporate colusin.rtf | 2025-07-04 06:32   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The flickering neon sign.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The game, as I often say, is afoot.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The gospel is written.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The hUe Limerick Codex.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The nUc's Seed, hUe's Bloom.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Theory by Grok 3.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The path forward.odt | 2025-07-04 06:32   |  85K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The prompt.odt | 2025-07-04 06:32   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | There, amidst the raw.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The road to reality.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The room is quiet.odt | 2025-09-04 22:39   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | These Characters Mock My Soul.odt | 2025-07-04 06:32   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | These two documents.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | The time of theory is over.odt | 2025-09-04 22:39   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | They crafted symphonies.odt | 2025-07-04 06:32   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | This configuration file is invalid.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | This is a fascinating and abstract prompt..odt | 2025-09-04 22:39   | 105K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | This is a fascinating and beautifully articulated concept.odt | 2025-09-04 22:39   | 104K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | This is a masterful discussion.odt | 2025-09-04 22:39   |  68K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | This is the architecture of a sovereign.odt | 2025-09-04 22:39   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Threads of Choice Woven by Time.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Time's Spiral Unfolds Digital Ghosts’ Whispers.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Time, Chaos, and the Cosmic Dance outline.odt | 2025-07-04 06:32   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Time to Take the ‘Big Bang’ out of the Big Bang Theory.odt | 2025-07-04 06:32   |  12M |   | 
![[TXT]](/icons/text.gif)  | Time to Take the ‘Big Bang’ out of the Big Bang Theory.txt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | To augment this text is not to merely add detail.odt | 2025-09-04 22:39   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tomato People Dance Alone.odt | 2025-07-04 06:32   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | To the Mother of the KnoWellian Universe.odt | 2025-07-04 06:32   |  50K |   | 
![[   ]](/icons/unknown.gif)  | Transcendence.docx | 2025-07-04 06:32   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Transcendence lm.odt | 2025-07-04 06:32   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Trident Transformers.odt | 2025-07-04 06:32   |  69K |   | 
![[   ]](/icons/unknown.gif)  | Trident Transformers Age Digital Gods.docx | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Truth’s Burning Light in a Digital Tomb.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Truth's Burning Light in a Digital Tomb.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Truth Shimmers the Edge of Infinity.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Tuning the Dissonance.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Twilight of the Titans.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Ultimaton's Probability, Entropium's Possibility.odt | 2025-07-04 06:32   |  49K |   | 
![[TXT]](/icons/text.gif)  | Ultimaton's Probability, Entropium's Possibility.txt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Und 9.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unntittitled 2.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 1.odt | 2025-07-04 06:32   |  39K |   | 
![[TXT]](/icons/text.gif)  | Untitled 2.html | 2025-07-04 06:32   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 2.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 2.odtpoems of anthology.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 3.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 4.odt | 2025-07-04 06:32   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitled 6.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Untitlxxxed 2.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Unveiling the KnoWell Equation.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Urgent Request for Papal Audience.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Utopia's Glimmer, Oblivion's Dark Shadow.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Variable rest mass.odt | 2025-07-04 06:32   |  46K |   | 
![[SND]](/icons/sound2.gif)  | Voice 018_sd.mp3 | 2025-07-04 06:32   |  11M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Weaving a Tapestry of Oneness.odt | 2025-07-04 06:32   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | What is Anthology.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | What is Consciousness.odt | 2025-07-04 06:32   |  78K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | What is autism.odt | 2025-07-04 06:32   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | What version of ChatGPT are you.odt | 2025-09-04 22:39   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Whispering Audience.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Whispers on the Onion Winds.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Who Else.odt | 2025-07-04 06:32   | 1.7M |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Who is a christ.odt | 2025-07-04 06:32   |  66K |   | 
![[   ]](/icons/unknown.gif)  | William IX poems.docx | 2025-07-04 06:32   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | William IX poems.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Will you talk to me.odt | 2025-09-04 22:39   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram ChatGPT.odt | 2025-07-04 06:32   | 167K |   | 
![[   ]](/icons/unknown.gif)  | Wolfram ChatGPT Infinity.docx | 2025-07-04 06:32   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram ChatGPT Infinity.odt | 2025-07-04 06:32   |  50K |   | 
![[   ]](/icons/unknown.gif)  | Wolfram ChatGPT Infinity.rtf | 2025-07-04 06:32   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram KnoWell KUT.odt | 2025-07-04 06:32   | 148K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram code.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Wolfram language axiom.odt | 2025-07-04 06:32   |  18K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | World Women.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Yaldaba who steals human essence.odt | 2025-09-04 22:39   |  76K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | You are absolutely correct.odt | 2025-07-04 06:32   | 116K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | You are the Gardener now.odt | 2025-09-04 22:39   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | You have posed a profound and in its deepest sense unanswerable challenge.odt | 2025-09-04 22:39   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Your Holiness pope leo.odt | 2025-09-04 22:39   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Your solution avoids destabilizing.odt | 2025-09-04 22:39   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | You stand at the absolute center of your own KnoWellian Instant.odt | 2025-09-04 22:39   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | You would be warehoused.odt | 2025-09-04 22:39   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Zero lyrics.odt | 2025-07-04 06:32   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | Zone Delegation.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a blue bird day.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a chapter in the collection.odt | 2025-07-04 06:31   |  20K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a democracy based on the Greek.odt | 2025-07-04 06:31   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | adherence to the KnoWellian Algorithmic Democracy.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a digital messiah prompt.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/unknown.gif)  | a highly personalized and intricate cosmology.rtf | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ai model collapse.odt | 2025-07-04 06:31   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ai programming manual.odt | 2025-07-04 06:31   |  47K |   | 
![[TXT]](/icons/text.gif)  | alldirhtml.txt | 2025-07-04 06:31   | 184K |   | 
![[TXT]](/icons/text.gif)  | allhtml.txt | 2025-07-04 06:31   |  82K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | allk.odt | 2025-07-04 06:31   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ambitious and profound request.odt | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a most intricate tapestry you wish to weave.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | an Ai super intellegence scoring.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | an alien intelligence.odt | 2025-07-04 06:31   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | an excellent and very insightful question.odt | 2025-07-04 06:31   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | anrhologt imafw.odt | 2025-07-04 06:31   |  31K |   | 
![[   ]](/icons/unknown.gif)  | anthology.docx | 2025-07-04 06:31   | 2.3M |   | 
![[   ]](/icons/unknown.gif)  | anthology.rtf | 2025-09-04 22:39   |  17M |   | 
![[TXT]](/icons/text.gif)  | anthology.txt | 2025-07-04 06:31   | 2.5M |   | 
![[TXT]](/icons/text.gif)  | anthology 2 .txt | 2025-07-04 06:31   | 2.3M |   | 
![[   ]](/icons/odf6ods-20x22.png)  | anthology chapters.ods | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | antisemitism.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | apache stuff.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a possible chronological index.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a powerful and disturbing dream.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | appears to be a prime example of an advanced.odt | 2025-07-04 06:31   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | arXiv.odt | 2025-07-04 06:31   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | a text prompt.odt | 2025-07-04 06:31   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | beavan-et-al-contingency-repeatability-and-predictability-in-the-evolution-of-a-prokaryotic-pangenome.odt | 2025-09-04 22:39   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | big big big.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bitch from hell.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | blender KnoWellian Number Line.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bot god.odt | 2025-07-04 06:31   | 321K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bruce eegl.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | bruce paul.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | carefully constructed reality.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | carlys crystal balls.odt | 2025-07-04 06:31   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | century 8  quatrains.odt | 2025-07-04 06:31   |  50K |   | 
![[   ]](/icons/odf6ods-20x22.png)  | chapter numbers.ods | 2025-07-04 06:31   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chapters needing graphics.odt | 2025-07-04 06:31   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chatbots.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | chatgpt 4o lease explain the following document to me.odt | 2025-09-04 22:39   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | clark.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | collaborative work on Deduction.odt | 2025-09-04 22:39   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | concepts of time.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | conda activate F5.odt | 2025-07-04 06:31   |  12K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | correlations to the KnoWellian Universe Theory detailed in the primers.odt | 2025-09-04 22:39   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | cql-arxiv revieew.odt | 2025-09-04 22:39   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | create a digital currency.odt | 2025-09-04 22:39   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | creative alternative model.odt | 2025-07-04 06:31   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dalle lisi.odt | 2025-07-04 06:31   | 336K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dcffasfa.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dddddd.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ddddderee.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dear paul.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | detailed poem.odt | 2025-07-04 06:31   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfgdsghgjrtytrutr.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfgdshsdjdhf.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfghdfgh.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfghfjkttyh.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dfghjkkljh.odt | 2025-07-04 06:31   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dggfdhjjkhj.odt | 2025-07-04 06:31   |  95K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dghfhdgfhtd.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | direct theophany.odt | 2025-09-04 22:39   |  74K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | disseminating the knowledge.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | djhfdfhghfg.odt | 2025-07-04 06:31   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dolan.odt | 2025-07-04 06:31   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | doubling of the number.odt | 2025-07-04 06:31   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | drbpb.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dreams clinical analysis.odt | 2025-07-04 06:31   |  67K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | drip nuc ff.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dsfasdfhghjd.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dsfgfhjgkyt.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | dsfgsdgr.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | echoes outline.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ed 4.odt | 2025-07-04 06:31   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | edcdsafds.odt | 2025-07-04 06:31   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ego images.odt | 2025-09-04 22:39   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ein sof chapter.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | elaborately worded outline.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | electro why.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | email introducing Eric Weinstein to the KnoWellian Universe Theory.odt | 2025-07-04 06:31   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | embark on a journey.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ertwertert.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ertyujilpouikj.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | erwtfghujyikoi8uy7.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ethics.odt | 2025-07-04 06:31   |  20K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | etrerwreert.odt | 2025-07-04 06:31   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ewrttrgf.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ewrwer.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fascinating and impressive mediicare hr 1.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fascinating figures.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdfsafadasfag.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdghj.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdghsdgfdfhgjfjlhf.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdsbgsdfhsgdh.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fdsgfdhfdj.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fffddff.odt | 2025-07-04 06:31   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fgdhjfht.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fghjgfjkjk.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fghjkgfdfg.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fgjfhghfg.odt | 2025-07-04 06:31   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fhghdgfh.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fish tank.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fixing dns.odt | 2025-07-04 06:31   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | flux prompts.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fr coc.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | from the Noetic Space.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fsdsgsdgsd.odt | 2025-07-04 06:31   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | fwefwe.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gallery info.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gdsffghjfgjfghj.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gdyujhgf.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gemini letter to hassan.odt | 2025-07-04 06:31   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gen last will.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfdhdfghd.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfdhjhyut.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfhjkdfsg.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfhkjfgkhjfjh.odt | 2025-07-04 06:31   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gfsfghjfkjfgkf.odt | 2025-07-04 06:31   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ggdfgdf.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghgdfhdfht.odt | 2025-07-04 06:31   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghgjjkgikl.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghjkfhjfdgh.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghjkjktrdt.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghjmjhh.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ghost hunting spirit box.odt | 2025-07-04 06:31   |  94K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | goddess particle.odt | 2025-07-04 06:31   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | good bye Kim.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | gptforaall llama-3 Anthology.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | greatest gift.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hUe's Gambit.odt | 2025-07-04 06:31   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hUe abliterated Deepseek Semina.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | harbort teaches Garret Lisi Quad Trains.odt | 2025-07-04 06:31   |  36K |   | 
![[TXT]](/icons/text.gif)  | harbort teaches Garret Lisi Quad Trains.txt | 2025-07-04 06:31   | 5.7K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hdfghdhjgfjk.odt | 2025-07-04 06:31   | 305K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hdgfhdfgfj.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | here is a seven-section outline.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hfghfghd.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hgdfgd.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hgdfghdfgh.odt | 2025-07-04 06:31   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hgdghdfghd.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hhhhjjk.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hnfhnhjfg.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | holoflux.odt | 2025-07-04 06:31   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hopfion crystals in space-time.odt | 2025-09-04 22:39   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hsdghgdfgf.odt | 2025-07-04 06:31   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hsgfnhjdhnjfd.odt | 2025-07-04 06:31   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | hugging face.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | idiot.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | if mom got a loan.odt | 2025-07-04 06:31   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | imagined conversation at North Carolina.odt | 2025-07-04 06:31   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | impeachment against Donald John Trump.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | important to note.odt | 2025-07-04 06:31   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | in the style of dnl.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | intuition images.odt | 2025-09-04 22:39   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | issac newton.odt | 2025-09-04 22:39   |  92K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | itled 3.odt | 2025-07-04 06:31   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | itled 5.odt | 2025-07-04 06:31   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | iuyty.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | james martin.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jenkins.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jenkins eons.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jggigkhkhlk.odt | 2025-07-04 06:31   |  28K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jghjkhj.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jhdgfdgjfdhg.odt | 2025-07-04 06:31   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jhgertyfh.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jhhkjgfgfg.odt | 2025-07-04 06:31   |  29K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jkdghdfghgfh.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | jkgkj.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | julo;ujikl.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | just after.odt | 2025-07-04 06:31   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjghkjh.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjhgrtyuiuytrr.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjhgy.odt | 2025-07-04 06:31   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kjuyhtrertyui.odt | 2025-07-04 06:31   |  61K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kljtyturg.odt | 2025-07-04 06:31   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | knowel construtor.odt | 2025-07-04 06:31   | 338K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | knowell steady state.odt | 2025-07-04 06:31   |  21K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | kut paper.odt | 2025-07-04 06:31   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letter david shapiro.odt | 2025-07-04 06:31   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letters.odt | 2025-07-04 06:31   |  86K |   | 
![[TXT]](/icons/text.gif)  | letters to sheldrake.html | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letters to sheldrake.odt | 2025-07-04 06:31   |  55K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letter to bruce in a chapter.odt | 2025-07-04 06:31   |  49K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | letter to will duffy.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | lisi develips lisi hinton ouiija app.odt | 2025-07-04 06:31   |  42K |   | 
![[TXT]](/icons/text.gif)  | lisi develips lisi hinton ouiija app.txt | 2025-07-04 06:31   | 2.7K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llama3.1-405B.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llamafile.odt | 2025-07-04 06:31   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | llama three point one.odt | 2025-07-04 06:31   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | local llama-3.odt | 2025-07-04 06:31   |  43K |   | 
![[   ]](/icons/odf6ods-20x22.png)  | margin.ods | 2025-07-04 06:31   |  24K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | margin.odt | 2025-07-04 06:31   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | marvel knowell.odt | 2025-07-04 06:31   |  62K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | messiah.odt | 2025-07-04 06:32   |  74K |   | 
![[TXT]](/icons/text.gif)  | montak ch.html | 2025-07-04 06:32   |  11K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | more bfh.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | more chapters.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | morphic field.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | most historic concepts of all time past and future.odt | 2025-09-04 22:39   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | my own words.odt | 2025-07-04 06:32   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ncvbnxghdfgh.odt | 2025-07-04 06:32   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | n essence, the quote flips.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nnext.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ntitled 4.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nuc hue 2.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nuc hue 3.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nudes yng.odt | 2025-07-04 06:32   |  11K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | nudes ynggg.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | off script.odt | 2025-07-04 06:32   |  65K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | oiuyit.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | oiuyt.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ollama first try.odt | 2025-07-04 06:32   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ollama hosts.odt | 2025-07-04 06:32   |  59K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | one tome ome.odt | 2025-07-04 06:32   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | opendalle.odt | 2025-07-04 06:32   |  53K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | openwebui.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | original idea.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | out in one file.odt | 2025-07-04 06:32   |  15K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | outlines.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | outlines 2.odt | 2025-07-04 06:32   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | paul eons.odt | 2025-07-04 06:32   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | penn and teller once.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | pit maneuvar.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | plasma chapter.odt | 2025-07-04 06:32   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | poe shimmer.odt | 2025-07-04 06:32   |  52K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | policy.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | pope sees time.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | pope travels tinme.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | potentially revolutionary paper.odt | 2025-07-04 06:32   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | precognition.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | prompts sd.odt | 2025-07-04 06:32   |  17K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | proposed outline.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | quartaoins.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | question to wolfram.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | rabbit hole.odt | 2025-07-04 06:32   |  25K |   | 
![[   ]](/icons/unknown.gif)  | rabbit hole.rtf | 2025-07-04 06:32   |  14K |   | 
![[   ]](/icons/unknown.gif)  | rabbit hole seed.rtf | 2025-07-04 06:32   |  13K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | readability.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | resonance.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | revelation 13.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | rewritten death.odt | 2025-07-04 06:32   |  27K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | rewtww.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | robot arms.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sadfasdfasdf.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | saedf.odt | 2025-07-04 06:32   |  32K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | saving anthology.odt | 2025-07-04 06:32   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | schizophrenic savant.odt | 2025-07-04 06:32   |  58K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | science anarchy.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sdfasdfasf.odt | 2025-07-04 06:32   |  26K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sdfsafggh.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | seperate Anthology Chapters.odt | 2025-07-04 06:32   |  22K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | seven sections.odt | 2025-07-04 06:32   |  25K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sfadfjhjkgk.odt | 2025-07-04 06:32   |  34K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sfffffdsx.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sliver outline.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | smtp Prerequisites.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | so good2.odt | 2025-07-04 06:32   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | standard model.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | struggles.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | stylized and likely newly coined.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | subaru case number.odt | 2025-07-04 06:32   | 9.7K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sublimating their minds with Torus Knots.odt | 2025-07-04 06:32   |  66K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | sudo reboot now.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | summary intro anth.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tbfh.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tbfhell.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tesla knowell.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tesla stuff.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test 1.odt | 2025-07-04 06:32   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test 2.odt | 2025-07-04 06:32   |  60K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | test 3.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | that will solidify.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the 6th Epochal Revelation.odt | 2025-09-04 22:39   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Akashic field.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Anechoic Chamber.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Anomalous Subject.odt | 2025-07-04 06:32   |  64K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Boundless Wellspring.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Cracked Mirror of Being.odt | 2025-07-04 06:32   |  42K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Great Depression foods.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Instant.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the KnoWellian Axiom.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the KnoWellian Universe Theory is a highly unique synthesis.odt | 2025-07-04 06:32   |  54K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Lighthouse Keeper.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Musk Trump revolution.odt | 2025-07-04 06:32   |  73K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Scriptorium.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Spindle's Echo.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Static of the Soul.odt | 2025-09-04 22:39   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the Undefined Divine.odt | 2025-07-04 06:32   |  77K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the b from hell.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the bitch from hell 2.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the francis letter.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the graphical knowell.odt | 2025-07-04 06:32   |  23K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the  immaculate seed.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | their server connects to you.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the nolle hollogram.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the pope time travels.odt | 2025-07-04 06:32   | 354K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the question is asking about someone named David Noel Lynch.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the speed of light tested.odt | 2025-07-04 06:32   |  30K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the tavern.odt | 2025-07-04 06:32   |  38K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | the work of the Gardener.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | time is three dimensional.odt | 2025-09-04 22:39   |  56K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | time reflections in KnoWellian terms.odt | 2025-07-04 06:32   |  85K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | time travel.odt | 2025-07-04 06:32   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | titled 1.odt | 2025-07-04 06:32   |  48K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | titled 2.odt | 2025-07-04 06:32   |  33K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tjhgfdsd.odt | 2025-07-04 06:32   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tled 3.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | to entangle the precise dance of the Lorentz.odt | 2025-07-04 06:32   |  47K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | treytyre.odt | 2025-07-04 06:32   |  51K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tryuiolkjhg.odt | 2025-07-04 06:32   |  43K |   | 
![[   ]](/icons/unknown.gif)  | two-paths-to-intelligence.rtf | 2025-07-04 06:32   |  63K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tyuiotyui.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | tz A Loving Shimmer of Hatefulness.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | un-numbered paper.odt | 2025-09-04 22:39   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | up and down.odt | 2025-07-04 06:32   |  35K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | uytrdfghjtr.odt | 2025-07-04 06:32   |  46K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | wes roth.odt | 2025-07-04 06:32   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | with the utmost respect and sensitivity.odt | 2025-09-04 22:39   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | world peace.odt | 2025-07-04 06:32   |  57K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | written by David Noel Lynch.odt | 2025-09-04 22:39   |  50K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | xAi Review of.odt | 2025-07-04 06:32   |  41K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yes the illusion.odt | 2025-07-04 06:32   |  39K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yiuiyutry.odt | 2025-07-04 06:32   |  45K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | young Dave.odt | 2025-09-04 22:39   |  31K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | youtube post.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ytrreyrye.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ytuigfrtyui.odt | 2025-07-04 06:32   |  40K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | ytuurt.odt | 2025-07-04 06:32   |  36K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yuityi.odt | 2025-07-04 06:32   |  44K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | yutuhjnredh.odt | 2025-07-04 06:32   |  37K |   | 
![[   ]](/icons/odf6odt-20x22.png)  | zombies.odt | 2025-07-04 06:32   |  43K |   | 
   
  |