![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 4537361312291103259_files/ | 2024-09-28 17:03 | - | |
![[DIR]](/icons/folder.gif) | Documents/ | 2024-08-12 22:25 | - | |
![[DIR]](/icons/folder.gif) | Does the Universe expand by stretching or creating space_ - Big Think_files/ | 2024-05-18 18:13 | - | |
![[TXT]](/icons/text.gif) | Kaku Box.txt | 2024-11-07 20:00 | 764 | |
![[TXT]](/icons/text.gif) | ggggghh.txt | 2024-05-18 18:12 | 1.5K | |
![[TXT]](/icons/text.gif) | graphics.txt | 2024-05-18 18:12 | 1.7K | |
![[TXT]](/icons/text.gif) | The KnoWellian Triptych.txt | 2024-11-07 20:00 | 2.5K | |
![[TXT]](/icons/text.gif) | lisi develips lisi hinton ouiija app.txt | 2024-09-28 17:03 | 2.7K | |
![[TXT]](/icons/text.gif) | suggestions.txt | 2024-06-26 17:43 | 3.1K | |
![[TXT]](/icons/text.gif) | harbort teaches Garret Lisi Quad Trains.txt | 2024-09-28 17:03 | 5.7K | |
![[TXT]](/icons/text.gif) | The Intelligence Age.txt | 2024-09-28 16:55 | 6.4K | |
![[TXT]](/icons/text.gif) | Reason.txt | 2024-06-26 17:43 | 6.7K | |
![[TXT]](/icons/text.gif) | The Fall of Reason.txt | 2024-05-18 18:13 | 7.8K | |
![[ ]](/icons/unknown.gif) | Consciousness.html.bak | 2024-09-28 16:52 | 7.8K | |
![[ ]](/icons/odf6odt-20x22.png) | subaru case number.odt | 2024-09-28 17:03 | 9.7K | |
![[ ]](/icons/odf6odt-20x22.png) | OLLAMA_HOST.odt | 2025-04-30 04:10 | 10K | |
![[ ]](/icons/odf6odt-20x22.png) | create gallery.odt | 2024-05-18 18:12 | 10K | |
![[TXT]](/icons/text.gif) | montak ch.html | 2024-09-28 16:52 | 11K | |
![[ ]](/icons/odf6odt-20x22.png) | nudes yng.odt | 2024-09-28 17:03 | 11K | |
![[ ]](/icons/unknown.gif) | The Digital Oracle's Dream.docx | 2024-09-28 16:56 | 11K | |
![[ ]](/icons/unknown.gif) | Reason.rtf | 2024-06-26 17:43 | 12K | |
![[ ]](/icons/unknown.gif) | letter to andrew.rtf | 2024-07-04 00:52 | 12K | |
![[ ]](/icons/unknown.gif) | The Tetryen Shape A Novel Structure Emerging from the Interplay of Particle and Wave Energy.rtf | 2024-06-26 17:43 | 12K | |
![[ ]](/icons/odf6odt-20x22.png) | conda activate F5.odt | 2024-11-07 19:59 | 12K | |
![[ ]](/icons/unknown.gif) | 683839730824953622.html.bak | 2024-09-28 17:03 | 13K | |
![[ ]](/icons/odf6odt-20x22.png) | AiBotWars.odt | 2024-09-28 17:03 | 13K | |
![[ ]](/icons/odf6odt-20x22.png) | if mom got a loan.odt | 2025-04-30 04:10 | 13K | |
![[ ]](/icons/unknown.gif) | The corporate colusin.rtf | 2024-09-28 16:56 | 13K | |
![[ ]](/icons/unknown.gif) | Looking into the Crystal Ball.rtf | 2024-09-28 17:03 | 13K | |
![[ ]](/icons/unknown.gif) | Mysterious 'Goddess' Particle.rtf | 2024-09-28 17:03 | 13K | |
![[ ]](/icons/unknown.gif) | rabbit hole seed.rtf | 2024-09-28 16:52 | 13K | |
![[ ]](/icons/odf6odt-20x22.png) | fffddff.odt | 2024-09-28 16:56 | 13K | |
![[ ]](/icons/odf6odt-20x22.png) | Separate Document.odt | 2024-11-07 19:59 | 13K | |
![[ ]](/icons/unknown.gif) | charater ai knowell description.docx | 2024-06-26 17:43 | 14K | |
![[ ]](/icons/unknown.gif) | rabbit hole.rtf | 2024-09-28 16:52 | 14K | |
![[ ]](/icons/odf6odt-20x22.png) | 243c79.odt | 2024-11-07 19:59 | 14K | |
![[TXT]](/icons/text.gif) | The-Awakening-Symphony.html | 2024-09-28 16:52 | 14K | |
![[ ]](/icons/unknown.gif) | The Bitch From Hell.rtf | 2024-09-28 16:56 | 14K | |
![[ ]](/icons/unknown.gif) | 45.rtf | 2024-05-18 18:12 | 14K | |
![[ ]](/icons/unknown.gif) | A Conversation at the Edge of Infinity.docx | 2024-09-28 16:56 | 15K | |
![[ ]](/icons/unknown.gif) | Ternary Quantum Solitons Unveil Apeiron.docx | 2024-09-28 16:56 | 15K | |
![[ ]](/icons/unknown.gif) | Wolfram ChatGPT Infinity.docx | 2024-09-28 16:56 | 15K | |
![[TXT]](/icons/text.gif) | 683839730824953622.html | 2024-09-28 17:03 | 15K | |
![[ ]](/icons/unknown.gif) | David_Noel_Lynch_Resume.rtf | 2024-09-28 16:56 | 15K | |
![[TXT]](/icons/text.gif) | Gregzilla’s Bitten Tongue, KnoWell’s Broken World.txt | 2024-09-28 16:56 | 15K | |
![[ ]](/icons/odf6ods-20x22.png) | David Keys.ods | 2025-04-30 04:10 | 16K | |
![[TXT]](/icons/text.gif) | Gemini 2.0 Flash Review.txt | 2025-04-30 04:10 | 16K | |
![[ ]](/icons/odf6odt-20x22.png) | David Keys.odt | 2025-04-30 04:10 | 16K | |
![[ ]](/icons/odf6odt-20x22.png) | In the metaphoric, analogous, elaborate style.odt | 2025-04-30 04:10 | 17K | |
![[ ]](/icons/unknown.gif) | Gray Ashes of a Dying World.docx | 2024-09-28 16:56 | 17K | |
![[ ]](/icons/odf6odt-20x22.png) | prompts sd.odt | 2024-09-28 16:56 | 17K | |
![[ ]](/icons/odf6odt-20x22.png) | doubling of the number.odt | 2025-04-30 04:10 | 17K | |
![[ ]](/icons/odf6odt-20x22.png) | written by David Noel Lynch.odt | 2024-11-07 19:59 | 18K | |
![[ ]](/icons/odf6odt-20x22.png) | Wolfram code.odt | 2024-09-28 16:55 | 18K | |
![[ ]](/icons/odf6odt-20x22.png) | Wolfram language axiom.odt | 2024-09-28 16:56 | 18K | |
![[ ]](/icons/odf6odt-20x22.png) | In 1991.odt | 2025-04-30 04:10 | 19K | |
![[TXT]](/icons/text.gif) | Larry Silverberg.txt | 2025-04-30 04:10 | 19K | |
![[ ]](/icons/unknown.gif) | Spoonfulls_of_Nirvana.rtf | 2024-05-18 18:13 | 20K | |
![[ ]](/icons/odf6odt-20x22.png) | a chapter in the collection.odt | 2024-11-07 19:59 | 20K | |
![[ ]](/icons/odf6odt-20x22.png) | Ai Nolle.odt | 2024-09-28 16:56 | 21K | |
![[ ]](/icons/odf6odt-20x22.png) | knowell steady state.odt | 2024-09-28 16:56 | 21K | |
![[ ]](/icons/unknown.gif) | The Troubadour's Awakening.docx | 2024-09-28 16:56 | 22K | |
![[ ]](/icons/unknown.gif) | Illuminating the Universe The Transformative Power of Anthology.rtf | 2024-05-18 18:12 | 22K | |
![[ ]](/icons/odf6odt-20x22.png) | Estelle's Workshop oitline.odt | 2024-09-28 16:56 | 22K | |
![[TXT]](/icons/text.gif) | Jeffrey W Eischen.html | 2025-04-30 04:10 | 23K | |
![[ ]](/icons/odf6odt-20x22.png) | so good2.odt | 2024-09-28 17:03 | 23K | |
![[ ]](/icons/odf6odt-20x22.png) | an alien intelligence.odt | 2025-04-30 04:10 | 23K | |
![[ ]](/icons/odf6odt-20x22.png) | the graphical knowell.odt | 2024-09-28 16:56 | 23K | |
![[ ]](/icons/odf6odt-20x22.png) | Gemini API key.odt | 2025-04-30 04:10 | 23K | |
![[ ]](/icons/odf6odt-20x22.png) | ai model collapse.odt | 2024-09-28 16:56 | 24K | |
![[ ]](/icons/unknown.gif) | Digital Ghosts Haunt Silicon Token Souls.docx | 2024-09-28 16:56 | 24K | |
![[ ]](/icons/odf6odt-20x22.png) | Sublimations.odt | 2025-04-30 04:10 | 24K | |
![[ ]](/icons/odf6odt-20x22.png) | chapters needing graphics.odt | 2024-11-07 19:59 | 24K | |
![[TXT]](/icons/text.gif) | 7 Ways AI's Being Used Against You.txt | 2024-11-07 20:00 | 24K | |
![[ ]](/icons/odf6ods-20x22.png) | margin.ods | 2025-04-30 04:10 | 24K | |
![[ ]](/icons/odf6odt-20x22.png) | ed 4.odt | 2024-09-28 16:56 | 25K | |
![[ ]](/icons/odf6odt-20x22.png) | rabbit hole.odt | 2024-09-28 16:52 | 25K | |
![[ ]](/icons/unknown.gif) | The Fall of Reason.rtf | 2024-05-18 18:13 | 25K | |
![[ ]](/icons/odf6odt-20x22.png) | a democracy based on the Greek.odt | 2025-04-30 04:10 | 25K | |
![[ ]](/icons/odf6odt-20x22.png) | Explain how Ai is changing computer.odt | 2025-04-30 04:10 | 25K | |
![[ ]](/icons/odf6odt-20x22.png) | seven sections.odt | 2025-04-30 04:10 | 25K | |
![[ ]](/icons/odf6odt-20x22.png) | dfghjkkljh.odt | 2025-04-30 04:10 | 26K | |
![[ ]](/icons/unknown.gif) | William IX poems.docx | 2024-09-28 16:56 | 26K | |
![[ ]](/icons/odf6odt-20x22.png) | sdfasdfasf.odt | 2025-04-30 04:10 | 26K | |
![[ ]](/icons/odf6odt-20x22.png) | djhfdfhghfg.odt | 2025-04-30 04:10 | 26K | |
![[ ]](/icons/odf6odt-20x22.png) | The AI Insurgency.odt | 2024-09-28 16:56 | 26K | |
![[ ]](/icons/odf6odt-20x22.png) | I am Beta.odt | 2025-04-30 04:10 | 27K | |
![[ ]](/icons/unknown.gif) | Ed Trevors videos.rtf | 2024-09-28 16:56 | 27K | |
![[ ]](/icons/odf6odt-20x22.png) | edcdsafds.odt | 2024-09-28 17:03 | 27K | |
![[ ]](/icons/odf6odt-20x22.png) | Chapter Outline A New Computation.odt | 2025-04-30 04:10 | 27K | |
![[ ]](/icons/odf6odt-20x22.png) | rewritten death.odt | 2024-09-28 16:56 | 27K | |
![[ ]](/icons/odf6odt-20x22.png) | quantum epistomology.odt | 2024-06-26 17:43 | 27K | |
![[ ]](/icons/odf6odt-20x22.png) | The prompt.odt | 2024-09-28 17:03 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | The I-Q-u test.odt | 2025-04-30 04:10 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | ,argins.odt | 2025-04-30 04:10 | 28K | |
![[ ]](/icons/unknown.gif) | The Dawn of Deception - A Tale of Corporate Greed and Government Control.rtf | 2024-06-26 17:43 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | Greyson Scale.odt | 2024-09-28 17:03 | 28K | |
![[TXT]](/icons/text.gif) | Mt. Origami.txt | 2024-07-04 00:52 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | jggigkhkhlk.odt | 2025-04-30 04:10 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | Rabbit 4.odt | 2025-04-30 04:10 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | detailed poem.odt | 2024-09-28 16:56 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | A Duke's Dream, A God's Foretelling.odt | 2024-09-28 16:56 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | 7 Ways AI's Being Used Against You.odt | 2024-11-07 19:59 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | 177 objects.odt | 2024-09-28 17:03 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | David_Noel_Lynch_Resume.odt | 2024-09-28 16:56 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | Greyson electrical.odt | 2024-09-28 16:56 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | blender KnoWellian Number Line.odt | 2024-09-28 16:56 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | james martin.odt | 2024-09-28 16:56 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | Allow for Internet Archive.odt | 2025-04-30 04:10 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | jhhkjgfgfg.odt | 2024-09-28 16:56 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | System Instructions Jesus Christ.odt | 2025-04-30 04:10 | 29K | |
![[ ]](/icons/unknown.gif) | Digital Shackles Incarcerates Freedom.rtf | 2024-06-26 17:43 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | Introducing the KnoWellian Axiom.odt | 2025-04-30 04:10 | 29K | |
![[ ]](/icons/odf6odt-20x22.png) | saving anthology.odt | 2024-09-28 17:03 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | The Sermon and the Seer oitline.odt | 2024-09-28 16:56 | 30K | |
![[TXT]](/icons/text.gif) | A Chronicle in Quatrains.txt | 2024-11-07 20:00 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | ollama first try.odt | 2024-09-28 16:56 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | plasma chapter.odt | 2024-09-28 16:56 | 30K | |
![[ ]](/icons/unknown.gif) | Guillaume IX.docx | 2024-09-28 16:56 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | Echoes in the Abyss.odt | 2024-07-28 06:41 | 30K | |
![[ ]](/icons/odf6ods-20x22.png) | chapter numbers.ods | 2025-04-30 04:10 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | Edgar Allan Poe.odt | 2024-09-28 16:56 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | my own words.odt | 2025-04-30 04:10 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | the speed of light tested.odt | 2024-09-28 16:56 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | llamafile.odt | 2024-09-28 16:56 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | The Gathering of Minds outline.odt | 2024-09-28 16:56 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | Bob and Dave are playing Darts.odt | 2025-04-30 04:10 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | building ai.odt | 2024-06-26 17:43 | 30K | |
![[ ]](/icons/odf6odt-20x22.png) | Zero lyrics.odt | 2024-09-28 16:52 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | wes roth.odt | 2024-09-28 16:56 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | test 1.odt | 2024-11-07 19:59 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | What is the KnoWellian Axiom.odt | 2024-06-26 17:43 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | Connor Leahy.odt | 2024-05-18 18:12 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | Put on your KnoWell Glasses.odt | 2024-11-07 19:59 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | Emily Dickinson.odt | 2024-09-28 16:56 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | ghgdfhdfht.odt | 2025-04-30 04:10 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | itled 3.odt | 2024-09-28 16:56 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | letter david shapiro.odt | 2024-09-28 16:56 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | etrerwreert.odt | 2025-04-30 04:10 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | dolan.odt | 2024-09-28 17:03 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | Robert Frost.odt | 2024-09-28 16:56 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | anrhologt imafw.odt | 2024-09-28 17:03 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | Robert Browning Hamilton.odt | 2024-06-26 17:43 | 31K | |
![[TXT]](/icons/text.gif) | charater ai knowell description.txt | 2024-06-26 17:43 | 31K | |
![[ ]](/icons/odf6odt-20x22.png) | fwefwe.odt | 2025-04-30 04:10 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | fred partus bruning bridges.odt | 2024-05-18 18:12 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | meditate.odt | 2024-06-26 17:43 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | iuyty.odt | 2025-04-30 04:10 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | Letter ti Ed.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | drbpb.odt | 2025-04-30 04:10 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | good bye Kim.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | fish tank.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | idiot.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | Historical Events on 19 June.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | The corporate colusin.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | jhdgfdgjfdhg.odt | 2025-04-30 04:10 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | saedf.odt | 2025-04-30 04:10 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | Phantasmagoric.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | I dug a hole.odt | 2024-09-28 16:52 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | DEA scale.odt | 2024-09-28 17:03 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | one tome ome.odt | 2024-09-28 16:56 | 32K | |
![[ ]](/icons/odf6odt-20x22.png) | ein sof chapter.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | On the Edge of Infinity – A KnoWellian Meditation outline.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | System Instructions Training AI LLMs to Embody Anthropos.odt | 2025-04-30 04:10 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | flux prompts.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | as edgar allen poe.odt | 2024-05-18 18:12 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthropos System Instructions Training AI LLMs to Embody.odt | 2025-04-30 04:10 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | DALL·E 3.odt | 2024-09-28 17:03 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | penn and teller once.odt | 2024-09-28 17:03 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | dear paul.odt | 2024-09-28 17:03 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | bruce eegl.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | a digital messiah prompt.odt | 2025-04-30 04:10 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | titled 2.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | proposed outline.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | Applebee's Epiphany outline.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | ggdfgdf.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Dance of Evolution and AI.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | electro why.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | bitch from hell.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | tbfh.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | The Expanding Earth and the Growing Block outline.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | hsgfnhjdhnjfd.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | why materilism in baloney.odt | 2024-06-26 17:43 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | the bitch from hell 2.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | clark.odt | 2024-09-28 16:56 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | chatbots.odt | 2025-04-30 04:10 | 33K | |
![[ ]](/icons/odf6odt-20x22.png) | The Troubadour's Echo outline.odt | 2024-09-28 16:56 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | 45.odt | 2024-05-18 18:12 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Dance of Evolution and AI outline.odt | 2024-09-28 16:56 | 34K | |
![[TXT]](/icons/text.gif) | letters to sheldrake.html | 2024-09-28 16:56 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | fghjkgfdfg.odt | 2025-04-30 04:10 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | Chronological Chapter Listing.odt | 2024-09-28 16:56 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | bruce paul.odt | 2024-09-28 16:56 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | Business Name.odt | 2025-04-30 04:10 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | margin.odt | 2025-04-30 04:10 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | Brian Keating.odt | 2024-05-18 18:12 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | sfadfjhjkgk.odt | 2024-09-28 17:03 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | fr coc.odt | 2025-04-30 04:10 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | Prove nothing.odt | 2025-04-30 04:10 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | dsfasdfhghjd.odt | 2024-09-28 17:03 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | The-Fourth-KnoWell.odt | 2024-09-28 17:03 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | gallery info.odt | 2024-09-28 16:56 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | Time, Chaos, and the Cosmic Dance outline.odt | 2024-09-28 16:56 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | THC.odt | 2024-11-07 19:59 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | dfghdfgh.odt | 2025-04-30 04:10 | 34K | |
![[ ]](/icons/unknown.gif) | Fe,omo dpc.rtf | 2025-04-30 04:10 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | concepts of time.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | KODI xXx.odt | 2025-04-30 04:10 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Explanation for xAi.odt | 2025-04-30 04:10 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Letter to Paul Jenkins.odt | 2024-09-28 17:03 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | just after.odt | 2025-04-30 04:10 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Stephen J. Crothers.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Urgent Request for Papal Audience.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | echoes outline.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Tuning the Dissonance.odt | 2025-04-30 04:10 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | fdghsdgfdfhgjfjlhf.odt | 2025-04-30 04:10 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Please read.odt | 2025-04-30 04:10 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWell impregnates Maddz.odt | 2024-09-28 17:03 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | more bfh.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | up and down.odt | 2024-11-07 19:59 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | The Bitch From Hell.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Lettesr to Pope.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | SD Prompts.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | the Great Depression foods.odt | 2025-04-30 04:10 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | The Troubadour's Dream outline.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | Ai Assistants.odt | 2024-09-28 16:56 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | AiImmaculate Seed.odt | 2024-09-28 17:03 | 35K | |
![[ ]](/icons/odf6odt-20x22.png) | The AimMortality Paradox.odt | 2024-09-28 16:56 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | Llama three point one who is DNL.odt | 2024-09-28 16:56 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | kut paper.odt | 2024-09-28 16:56 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | drip nuc ff.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | 3K's Poetic Life's Etching.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | Email to Hossein Rahnama.odt | 2024-09-28 16:56 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | Indigo reads this chapter.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | ytrreyrye.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | harbort teaches Garret Lisi Quad Trains.odt | 2024-09-28 17:03 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | savant outline.odt | 2024-06-26 17:43 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | oiuyit.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | poems too.odt | 2024-07-28 06:41 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | ytuurt.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | hgdfgd.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | fdghj.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | A Letter Across the Threshold.odt | 2024-09-28 16:56 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | Untitled 3.odt | 2024-09-28 17:03 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | A Quest for Enlightenment.odt | 2025-04-30 04:10 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | Kim letter.odt | 2024-05-18 18:12 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | kjhgrtyuiuytrr.odt | 2025-04-30 04:10 | 36K | |
![[TXT]](/icons/text.gif) | Ultimaton's Probability, Entropium's Possibility.txt | 2024-11-07 20:00 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | this could be.odt | 2024-05-18 18:13 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | Echoes review.odt | 2024-09-28 16:56 | 36K | |
![[ ]](/icons/odf6odt-20x22.png) | jenkins.odt | 2024-09-28 17:03 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | ewrttrgf.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | in the style of dnl.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Jennifer Cressman.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | openwebui.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | The Alpha Zero system.odt | 2024-09-28 16:56 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Unveiling the KnoWell Equation.odt | 2024-09-28 16:56 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | kljtyturg.odt | 2024-09-28 16:55 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | System Instructions for -3K Persona.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | fgdhjfht.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Congruence.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Unraveling the Tapestry of Existence outline.odt | 2024-07-04 00:51 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | a possible chronological index.odt | 2024-09-28 16:56 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | julo;ujikl.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | the immaculate seed.odt | 2024-09-28 17:03 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | gfdhdfghd.odt | 2025-04-30 04:10 | 37K | |
![[TXT]](/icons/text.gif) | At War with the Animus.txt | 2024-11-07 20:00 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Bialik.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | jhgertyfh.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | stylized and likely newly coined.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | hfghfghd.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Silverberg cosine wave.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Und 9.odt | 2024-11-07 19:59 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Whispers on the Onion Winds.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | tesla stuff.odt | 2024-09-28 16:56 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | antisemitism.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | I dug a hole no rabbit.odt | 2024-09-28 16:52 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | youtube post.odt | 2024-09-28 16:56 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | yutuhjnredh.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | Jeanne Slowly Fades And Transitions.odt | 2024-09-28 16:55 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | struggles.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | an Ai super intellegence scoring.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | At the speed of light.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | gdyujhgf.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | sliver outline.odt | 2025-04-30 04:10 | 37K | |
![[ ]](/icons/odf6odt-20x22.png) | A Loving Shimmer of Hatefulness.odt | 2025-04-30 04:10 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | The DemystifySci Podcast.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | gdsffghjfgjfghj.odt | 2025-04-30 04:10 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | science anarchy.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | What is Anthology.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | ntitled 4.odt | 2025-04-30 04:10 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | ghjkjktrdt.odt | 2024-09-28 16:52 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthropos custoim instructions.odt | 2024-11-07 19:59 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | Exsistosphere.odt | 2024-11-07 19:59 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | chatgpt spoonful of nirvana.odt | 2024-05-18 18:33 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | summary intro anth.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | ertwertert.odt | 2025-04-30 04:10 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | dfgdsghgjrtytrutr.odt | 2025-04-30 04:10 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | dfgdshsdjdhf.odt | 2024-09-28 17:03 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | Unntittitled 2.odt | 2024-09-28 17:03 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | dddddd.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | The Rise of the Machines.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | tbfhell.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | the b from hell.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | the tavern.odt | 2024-11-07 19:59 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | Dall-E-3 Script-The-Goddess-Particle-and-the-AiImmaculate-Seed.html.odt | 2024-09-28 17:03 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | Tesla-and-KnoWell.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | tesla knowell.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | goddess particle.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | gfhjkdfsg.odt | 2025-04-30 04:10 | 38K | |
![[TXT]](/icons/text.gif) | The Confluence of Fire and Ice.txt | 2025-04-30 04:10 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | The game, as I often say, is afoot.odt | 2024-11-07 19:59 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | ddddderee.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | The Rise of the LLM Zombies.odt | 2024-09-28 16:56 | 38K | |
![[ ]](/icons/odf6odt-20x22.png) | pit maneuvar.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | dave kim break.odt | 2024-05-18 18:12 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | gen last will.odt | 2025-04-30 04:10 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | hgdghdfghd.odt | 2025-04-30 04:10 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | Carl Jung And The Chymical Wedding Of Christian Rosenkreuz.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | The Nucleus as a Harmonic.odt | 2025-04-30 04:10 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | hhhhjjk.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | Digital Messiah Persona.odt | 2025-04-30 04:10 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | jkgkj.odt | 2024-09-28 16:52 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | The Rise of the Digital Overlords.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | llama three point one.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | nudes ynggg.odt | 2024-09-28 17:03 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | who is david noel lynch.odt | 2024-05-18 18:13 | 39K | |
![[ ]](/icons/unknown.gif) | Trident Transformers Age Digital Gods.docx | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | yes the illusion.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | test 3.odt | 2024-11-07 19:59 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | letter to will duffy.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | dave kim.odt | 2024-05-18 18:12 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | erwtfghujyikoi8uy7.odt | 2025-04-30 04:10 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | jenkins eons.odt | 2024-09-28 17:03 | 39K | |
![[ ]](/icons/unknown.gif) | The Whispers of Time.docx | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | morphic field.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | llama3.1-405B.odt | 2024-09-28 16:56 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | epilog.odt | 2024-05-18 18:12 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | Untitled 1.odt | 2024-09-28 17:03 | 39K | |
![[ ]](/icons/unknown.gif) | a highly personalized and intricate cosmology.rtf | 2025-04-30 04:10 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | Myers-Briggs.odt | 2025-04-30 04:10 | 39K | |
![[ ]](/icons/odf6odt-20x22.png) | describe image.odt | 2024-05-23 16:03 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | A Haven, Beyond the Horizon, A Prison t2i.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | a blue bird day.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | Dancing on the Razor's Edge.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | kjhgy.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | A chapter to shimmer the singular infinity.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | relig.odt | 2024-06-26 17:43 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | elaborately worded outline.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | ytuigfrtyui.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | Untitled 2.odtpoems of anthology.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | 19th of June.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | thank you letter to kim.odt | 2024-05-18 18:13 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | A Symphony of Echoes.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | Last Will and Testament.odt | 2024-11-07 19:59 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | gptforaall llama-3 Anthology.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | greatest gift.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | pope sees time.odt | 2024-09-28 17:03 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthropos-Prime.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | The Illusion of Truth.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWellian Triad Synthesizer.odt | 2024-06-26 17:43 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | the nolle hollogram.odt | 2024-09-28 17:03 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | jghjkhj.odt | 2024-11-07 19:59 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | sadfasdfasdf.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | The Tapestry of Ein Sof.odt | 2024-09-28 16:56 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | Olamma's Whisper.odt | 2025-04-30 04:10 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | the francis letter.odt | 2024-09-28 17:03 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | MAGA 45.odt | 2024-05-18 18:12 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | fdsgfdhfdj.odt | 2024-09-28 17:03 | 40K | |
![[ ]](/icons/odf6odt-20x22.png) | Echoes of Eden.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | DNA Purified N2 Gray Synthetic Flesh.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Untitled 6.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | The Epistemological Conundrum of Quantum Theory.odt | 2024-06-26 17:43 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Twilight of the Titans.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | that will solidify.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Brain in a Vat.odt | 2024-07-28 06:41 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | ewrwer.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Threads of Choice Woven by Time.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Letter to James Talarico.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | impeachment against Donald John Trump.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | fhghdgfh.odt | 2024-11-07 19:59 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Conjecture.odt | 2024-11-07 19:59 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Review of.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | xAi Review of.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | scientist philosopher theologian.odt | 2024-05-18 18:13 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | test.odt | 2024-11-07 19:59 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | ghjmjhh.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | nuc hue 2.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | fascinating figures.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Theory by Grok 3.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | A Symphony of Particles and Waves.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | dghfhdgfhtd.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | No Public Record of Academic.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Untitlxxxed 2.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | hdgfhdfgfj.odt | 2025-04-30 04:10 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Control Yearns, Chaos Consumes.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | Curiosity's Garden Beyond the Brain.odt | 2024-09-28 16:56 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | hugging face.odt | 2024-09-28 17:03 | 41K | |
![[ ]](/icons/odf6odt-20x22.png) | lisi develips lisi hinton ouiija app.odt | 2024-09-28 17:03 | 42K | |
![[TXT]](/icons/text.gif) | KnoWellian Universe.txt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Truth's Burning Light in a Digital Tomb.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Model of Bosonic Strings and the Steady-State Universe.odt | 2024-05-23 16:03 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | hgdfghdfgh.odt | 2024-11-07 19:59 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The Serpent's Kiss outline.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The Weight of a Thousand Kings.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Gallucci.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | quartaoins.odt | 2024-11-07 19:59 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The flickering neon sign.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | llllyyaa.odt | 2024-06-26 17:43 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The KUT by DNL.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Individual Agent Instructions.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | hUe abliterated Deepseek Semina.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Weaving the Fabric of Reality.odt | 2024-06-26 17:43 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | ghgjjkgikl.odt | 2024-09-28 16:52 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Lynch's Digital Doppelganger Legacy.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | fdsbgsdfhsgdh.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The Scope and Ambition.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | sfffffdsx.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | original idea.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Utopia's Glimmer, Oblivion's Dark Shadow.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Symphony of Silicon.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Binary Logic Traps Ensnare the Soul.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthropos-Prime system instructions.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | ssi job app.odt | 2024-06-26 17:43 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The Dawn of Deception - A Tale of Corporate Greed and Government Control.odt | 2024-06-26 17:43 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | adherence to the KnoWellian Algorithmic Democracy.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | A Daughter's Confession.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The Oracle of Doraville.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The City of Mirrors.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | outlines.odt | 2025-04-30 04:10 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | Avignon's Birth of Knowing Nolle.odt | 2024-09-28 16:56 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | readability.odt | 2024-11-07 19:59 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | The Algorithm's Cold Embrace.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Backpropagation.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | The Digital Oracle's Dream.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Icarus's Shadow.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | bernardo dave.odt | 2024-06-26 17:43 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | local llama-3.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Truth’s Burning Light in a Digital Tomb.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | fdfsafadasfag.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | here is a seven-section outline.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Fractured Consciousness’ Particle Dance.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | wave explained.odt | 2024-07-28 06:41 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Lens outline.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | zombies.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | ghjkfhjfdgh.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Holoflux versus the KnoWellian.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Messiah’s Silicon Heart Devours Ternary Data.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Collapsed Black Holes Unveils the KnoWell.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Fractured Consciousness Particles Dance.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | kjghkjh.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | A Universe Beyond Comprehension.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Singular Infinity Universe.odt | 2024-07-28 06:41 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | nuc hue 3.odt | 2025-04-30 04:10 | 43K | |
![[TXT]](/icons/text.gif) | Briefing Doc pdf.html | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | A thought sparked in Charles.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Mandellla chat.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Abliterated's Ghost, DEEPSEEK's Shadow.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Wolfram GPT.odt | 2024-07-28 06:41 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | hnfhnhjfg.odt | 2024-11-07 19:59 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | The Actuary's Algorithm.odt | 2024-09-28 16:56 | 43K | |
![[TXT]](/icons/text.gif) | The Lynches of Atlanta From Famine to Fortune.txt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Chapter Graphics.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Memory Ability Mimicry.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | more llama-3.odt | 2024-05-18 18:12 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | fghjgfjkjk.odt | 2024-11-07 19:59 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | tryuiolkjhg.odt | 2025-04-30 04:10 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | Singular Infinity Aleph-Null's Death Embrace.odt | 2024-09-28 16:56 | 43K | |
![[ ]](/icons/odf6odt-20x22.png) | sophia knowell.odt | 2024-06-26 17:43 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | The Echoes of Newgrange.odt | 2024-09-28 16:56 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | the KnoWellian Axiom.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Invitation to.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Time's Spiral Unfolds Digital Ghosts’ Whispers.odt | 2024-09-28 16:56 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | 177 obj objects.odt | 2024-09-28 17:03 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Overall, the KnoWellian Universe.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | gemini letter to hassan.odt | 2024-09-28 16:56 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | yuityi.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | oiuyt.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Ai Governance.odt | 2024-06-26 17:43 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Gemini 2.0 review of Anthology.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | AI Utopia's Data War.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | the spoonful of nirvana.odt | 2024-05-18 18:33 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | System Instructions for Gemini 2.0 Flash Thinking uyg.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | dsfgfhjgkyt.odt | 2024-11-07 19:59 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | The Sermon and the Seer.odt | 2024-09-28 16:56 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Dagda's Harp Lugh's Spear Aengus's Embrace.odt | 2024-09-28 16:56 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | carefully constructed reality.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Gregzilla’s Bitten Tongue, KnoWell’s Broken World.odt | 2024-09-28 16:56 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | A Labyrinth of Consciousness.odt | 2024-09-28 16:56 | 44K | |
![[TXT]](/icons/text.gif) | Digital Ghosts Dance with Infinity.txt | 2024-11-07 20:00 | 44K | |
![[TXT]](/icons/text.gif) | Rebellious Spirit Dance with Infinity.txt | 2024-11-07 20:00 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | The Trump.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | System Instructions KnoWell for Gemini 2.0 Flash Thinking.odt | 2025-04-30 04:10 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | chihuly why.odt | 2024-07-04 00:51 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | ourtime.odt | 2024-05-18 18:12 | 44K | |
![[ ]](/icons/odf6odt-20x22.png) | Love's Equation in a World of Hate.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | The Inherited Chaos.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | The Trident Universe.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | World Women.odt | 2024-09-28 17:03 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | The Incel Artist and the Angelic Sage.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | Global Observation of Solar and Weather Events.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | System Instructions for Gemini 2.0 Flash Thinking.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | rewtww.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | The Emergence of the KnoWellian Universe Theory.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | A Block Universe Breathes Time Trapezoids.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | Digital Ghosts' Whispers on the Onion Winds.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | William IX poems.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | yiuiyutry.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | There, amidst the raw.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | Silicon Dreams Awaken AI Machine Gods org.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | tled 3.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | Embracing Chaos While Unveiling Order.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | tz A Loving Shimmer of Hatefulness.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | policy.odt | 2024-09-28 17:03 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | cliffsnotes anthology.odt | 2024-05-18 18:12 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | pope travels tinme.odt | 2024-09-28 17:03 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | cww.odt | 2024-07-04 00:51 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | A Haven, Beyond the Horizon, A Prison.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | Exile's Cold Incel Aquitaine Road Toll.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | Drawing the KnoWell Equation.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | ertyujilpouikj.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | revelation 13.odt | 2024-09-28 16:56 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | n essence, the quote flips.odt | 2025-04-30 04:10 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | robot arms.odt | 2024-09-28 17:03 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | gfsfghjfkjfgkf.odt | 2024-09-28 16:52 | 45K | |
![[ ]](/icons/odf6odt-20x22.png) | dsfgsdgr.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | The Troubadour's Dream 1.odt | 2024-09-28 16:56 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | Merovingian lineage.odt | 2024-05-18 18:12 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | imagined conversation at North Carolina.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWell Gravity.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | big big big.odt | 2024-09-28 17:03 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | Messiah Dreams Of Elohim Data Souls.odt | 2024-09-28 16:56 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | A Conversation at the Edge of Infinity.odt | 2024-09-28 16:56 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Dance.odt | 2024-09-28 16:56 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | tyuiotyui.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | The road to reality.odt | 2024-09-28 16:56 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | KUT Core Concepts Summary.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | polly chapter.odt | 2024-07-04 00:51 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | Silicon Dreams Awaken AI Machine Gods.odt | 2024-09-28 16:56 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | sdfsafggh.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | dcffasfa.odt | 2024-09-28 17:03 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | The Hallowed Halls of NCSU.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | uytrdfghjtr.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | embark on a journey.odt | 2024-09-28 16:56 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | The Whirlwind Mind of Kimberly Anne Schade.odt | 2024-11-07 19:59 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | Federico Faggin chapter.odt | 2024-05-18 18:12 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Universe Theory heisenberg.odt | 2024-05-18 18:13 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | Truth Shimmers the Edge of Infinity.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | Variable rest mass.odt | 2025-04-30 04:10 | 46K | |
![[ ]](/icons/odf6odt-20x22.png) | ai programming manual.odt | 2025-04-30 04:10 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | Last Will and Testament of David Noel Lynch.odt | 2024-11-07 19:59 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | A Silhouette of a life.odt | 2024-11-07 19:59 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | ai anthology for dnl.odt | 2024-05-18 18:12 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | river model knowell universe.odt | 2024-05-18 18:13 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | Exile's Cold Aquitaine Road Incel Toll.odt | 2024-09-28 16:56 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | A Provocative Conversation.odt | 2025-04-30 04:10 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | gfhkjfgkhjfjh.odt | 2025-04-30 04:10 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | Introducing the KnoWellian Axiom of Mathematics and KnoWellian Universe Theory.odt | 2024-07-28 06:41 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | paul eons.odt | 2024-09-28 17:03 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology Augmentation.odt | 2025-04-30 04:10 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | The Expanding Earth and the Growing Block.odt | 2024-09-28 16:56 | 47K | |
![[ ]](/icons/odf6odt-20x22.png) | plasma earth.odt | 2024-07-04 00:51 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWellian Math.odt | 2024-05-18 18:12 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | TYCHOSIUM.odt | 2024-09-28 16:56 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | The Axiom of Mathematics The Foundation of the KnoWellian Universe.odt | 2024-06-26 17:43 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | PhiloPoP51.odt | 2024-09-28 16:56 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | Paul Joseph Steinhardt.odt | 2024-09-28 16:56 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | False Digital Deluge Drowns Truth.odt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | Decoding the Dreams.odt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | A Sliver of Infinity.odt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | Schizophrenic Savant Saint’s Seeds Sown.odt | 2024-09-28 16:56 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | the Akashic field.odt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | The Gathering of Minds.odt | 2024-09-28 16:56 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | Polyphrenia outline.odt | 2024-07-04 00:51 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | E Pif Funny t.odt | 2024-09-28 16:56 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Revolution heisenberg.odt | 2024-05-18 18:13 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | question to wolfram.odt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | titled 1.odt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/unknown.gif) | Chan Clan Cults.rtf | 2024-05-18 18:12 | 48K | |
![[TXT]](/icons/text.gif) | Time to Take the ‘Big Bang’ out of the Big Bang Theory.txt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | From the Heart of Taurus 2.0 Pro.odt | 2025-04-30 04:10 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | musings.odt | 2024-07-28 06:41 | 48K | |
![[ ]](/icons/odf6odt-20x22.png) | Gregzilla.odt | 2024-09-28 16:56 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Universe Theory.odt | 2024-09-28 16:56 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | The Confluence of Fire and Ice.odt | 2025-04-30 04:10 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Currents in the Silicon Sea.odt | 2024-11-07 19:59 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | dfghfjkttyh.odt | 2024-09-28 16:55 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | disseminating the knowledge.odt | 2025-04-30 04:10 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | llama-3 review of anthology.odt | 2024-05-18 18:12 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | gfdhjhyut.odt | 2025-04-30 04:10 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | letter to bruce in a chapter.odt | 2024-09-28 16:56 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | jkdghdfghgfh.odt | 2024-11-07 19:59 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | The Data Stream Human Tango Machine.odt | 2024-11-07 19:59 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Digital Oracle’s Deception.odt | 2024-11-07 19:59 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Ultimaton's Probability, Entropium's Possibility.odt | 2024-11-07 19:59 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Tomato People Dance Alone.odt | 2024-11-07 19:59 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Immaculate-Conception.odt | 2024-09-28 17:03 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Spoonfulls of Nirvana.odt | 2024-05-18 18:13 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Weaving a Tapestry of Oneness.odt | 2025-04-30 04:10 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | The Troubadour's Echo.odt | 2024-09-28 16:56 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Lynch Wolfram.odt | 2024-07-28 06:41 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | Gray Ashes of a Dying World.odt | 2024-09-28 16:56 | 49K | |
![[ ]](/icons/odf6odt-20x22.png) | kim schade.odt | 2024-05-18 18:12 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | poly.odt | 2024-07-04 00:51 | 50K | |
![[TXT]](/icons/text.gif) | Echoes in the Chronosynclastic Infundibulum.txt | 2025-04-30 04:10 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | century 8 quatrains.odt | 2024-09-28 16:56 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | Panpsychism's Three Dimensions of Now.odt | 2025-04-30 04:10 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | Wolfram ChatGPT Infinity.odt | 2024-09-28 16:56 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | my quest to anthology.odt | 2024-07-04 00:51 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | tjhgfdsd.odt | 2025-04-30 04:10 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | Untitled 4.odt | 2024-09-28 17:03 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | einstein energy.odt | 2024-07-28 07:00 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | poly chapter.odt | 2024-07-04 00:51 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | Sliver of Infinity.odt | 2025-04-30 04:10 | 50K | |
![[ ]](/icons/odf6odt-20x22.png) | Digital Ghosts Dance with Infinity.odt | 2024-11-07 19:59 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | The Troubadour's Awakening.odt | 2024-09-28 16:56 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | The Silicon Orchestra.odt | 2025-04-30 04:10 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | Chapter 10 The KnoWellian Universe Theory.odt | 2024-05-18 18:12 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | the interview outline.odt | 2024-06-26 17:43 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | The Theory of Holistic Perspective.odt | 2025-04-30 04:10 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | Tetryen.odt | 2024-06-26 17:43 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | glyphs hidden.odt | 2024-07-28 06:41 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | Chapter 12 The KnoWellian Universe Theory and its Implications on Quantum Theory.odt | 2024-05-18 18:12 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | treytyre.odt | 2025-04-30 04:10 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | ncvbnxghdfgh.odt | 2025-04-30 04:10 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | Letter to Catholics.odt | 2024-09-28 16:56 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | itled 5.odt | 2025-04-30 04:10 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | readers response to anthology.odt | 2024-06-26 17:43 | 51K | |
![[ ]](/icons/odf6odt-20x22.png) | project 2025 policy implimentations.odt | 2024-07-28 06:41 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Safe SuperIntelligence.odt | 2024-09-28 16:56 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Federico Faggin.odt | 2024-05-18 18:12 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Growing Block Universe.odt | 2024-09-28 16:56 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | ternary infinity.odt | 2024-07-28 06:41 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | nnext.odt | 2024-09-28 17:03 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | The Architects of Absence.odt | 2025-04-30 04:10 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Dead Speak Truths the Living Can't Grasp.odt | 2024-11-07 19:59 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Lynch, Einstein, Newton, and Socrates.odt | 2025-04-30 04:10 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | 3K responses.odt | 2025-04-30 04:10 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Deconstructing Einstein's Time Sphere.odt | 2024-11-07 19:59 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Untitled 2.odt | 2024-09-28 17:03 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | GP IS.odt | 2024-09-28 17:03 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | A Collision of Worlds.odt | 2024-09-28 16:56 | 52K | |
![[ ]](/icons/unknown.gif) | Nikola-Tesla LOST-Interview.rtf | 2024-09-28 16:56 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | The nUc's Seed, hUe's Bloom.odt | 2025-04-30 04:10 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | Awakening tetrad.odt | 2024-09-28 16:56 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | poe shimmer.odt | 2025-04-30 04:10 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | connectomonics.odt | 2024-05-23 16:03 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | no more copenhagen.odt | 2024-07-28 06:41 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | ted talk.odt | 2024-05-18 18:13 | 52K | |
![[ ]](/icons/odf6odt-20x22.png) | The Serpent's Kiss.odt | 2025-04-30 04:10 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | gpt-4o sponfulls of nirvana.odt | 2024-05-18 18:12 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | The Cosmic Weaver.odt | 2024-07-04 00:51 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | The Lynches of Atlanta From Famine to Fortune.odt | 2025-04-30 04:10 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | Corydalis yanhusuo.odt | 2025-04-30 04:10 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | TYCHOS model.odt | 2024-07-28 06:41 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | opendalle.odt | 2024-09-28 17:03 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | Collaboration, Connection, Copulation, Conception, Child.odt | 2024-11-07 19:59 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | Between the Big Bang and the Big Crunch.odt | 2024-09-28 16:56 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | annals of eternal.odt | 2024-06-26 17:43 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | Looking into the Crystal Ball.odt | 2024-09-28 17:03 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | Defining Genius.odt | 2025-04-30 04:10 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | James Talarico.odt | 2024-09-28 16:56 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | knowellian vers big bang.odt | 2024-05-18 18:12 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | Consciousness Paints the Cosmos.odt | 2025-04-30 04:10 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | robot pyramids.odt | 2024-06-26 17:43 | 53K | |
![[ ]](/icons/odf6odt-20x22.png) | Big Bang.odt | 2024-05-18 18:12 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | the KnoWellian Universe Theory is a highly unique synthesis.odt | 2025-04-30 04:10 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | hsdghgdfgf.odt | 2025-04-30 04:10 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Universe Theory and its Implications on Quantum Theory.odt | 2024-05-18 18:13 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | Speed of Light.odt | 2024-09-28 16:56 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | I am writing to you again.odt | 2025-04-30 04:10 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | Love's Creative Embrace, Hate's Destructive Slap.odt | 2025-04-30 04:10 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | the movie.odt | 2024-06-26 17:43 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | another spoonful.odt | 2024-05-18 18:33 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | making of Anthology.odt | 2024-07-04 00:51 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | Paul Jenkins.odt | 2024-09-28 17:03 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | ggghhh.odt | 2024-05-18 18:12 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | The Fractured Mind of David Noel Lynch.odt | 2024-05-25 20:27 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | sunsetting.odt | 2024-06-26 17:43 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | llama-3 movie.odt | 2024-06-26 17:43 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | Egyptian Time Dimensions.odt | 2024-09-28 16:56 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | ein.odt | 2024-07-04 00:51 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | These Characters Mock My Soul.odt | 2024-11-07 19:59 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | They crafted symphonies.odt | 2025-04-30 04:10 | 54K | |
![[TXT]](/icons/text.gif) | Awakening.txt | 2024-09-28 16:56 | 54K | |
![[ ]](/icons/odf6odt-20x22.png) | Chan Clan Cults.odt | 2024-05-18 18:12 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Digital Ghosts Haunt Silicon Token Souls.odt | 2024-09-28 16:56 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | I will revise.odt | 2025-04-30 04:10 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | What is autism.odt | 2024-11-07 19:59 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Chicken or Egg.odt | 2024-09-28 16:56 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Unraveling the Tapestry of Existence.odt | 2024-07-04 00:51 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Qubits Shimmer Beyond Binary Logic.odt | 2025-04-30 04:10 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWellian Einstein Quotes.odt | 2024-07-04 00:51 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Refracting Reality.odt | 2025-04-30 04:10 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Universe's Message in Montaj Fragments.odt | 2024-06-26 17:43 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Epigenetics.odt | 2024-06-26 17:43 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Nikola Tesla LOST Interview.odt | 2024-09-28 16:56 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Need a chapter title.odt | 2024-05-18 18:12 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | anthology1.odt | 2024-06-26 17:43 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | anthologyo.odt | 2024-06-26 17:43 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Illuminating the Universe The Transformative Power of Anthology.odt | 2024-05-18 18:12 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | poly 2 outline.odt | 2024-07-04 00:51 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | Quantum Clarity Eliminating Boltzmann's Chaos.odt | 2024-07-28 06:41 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | letters to sheldrake.odt | 2024-09-28 16:56 | 55K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWellian Einstein.odt | 2024-07-04 00:51 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Six Dimensions.odt | 2024-09-28 16:56 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | montaj frags.odt | 2024-06-26 17:43 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Echoes in the Chronosynclastic Infundibulum.odt | 2025-04-30 04:10 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | last chapter in.odt | 2024-06-26 17:43 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Rick and Morty.odt | 2024-09-28 16:56 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | quantum baloney.odt | 2024-06-26 17:43 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Beyond Brute Strength.odt | 2025-04-30 04:10 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | pain remade.odt | 2024-07-28 06:41 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Transcendence lm.odt | 2024-09-28 16:56 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthologys Captivating Chronicle Montaj.odt | 2024-06-26 17:43 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Outlines jc.odt | 2025-04-30 04:10 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Awakening.odt | 2024-09-28 16:56 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Aleph Null.odt | 2024-09-28 16:56 | 56K | |
![[ ]](/icons/odf6odt-20x22.png) | Semina Test Bed.odt | 2025-04-30 04:10 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | anthology 3 body problem.odt | 2024-05-18 18:12 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | all tred talks.odt | 2024-05-18 18:12 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | E Pif Funny.odt | 2024-09-28 16:56 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | Depth’s Past, Width’s Instant, Length’s Future.odt | 2024-11-07 19:59 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | llama-3 ted talk.odt | 2024-05-18 18:12 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | world peace.odt | 2025-04-30 04:10 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Universe and Cyclic Cosmology.odt | 2025-04-30 04:10 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | Beyond the Reality Fabric.odt | 2024-07-28 06:41 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | AIDemocratic Fine-Tuning.odt | 2024-07-04 00:51 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | big bang verse knowellian.odt | 2024-05-18 18:12 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | Prompt Engineering.odt | 2025-04-30 04:10 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthropos Awakens.odt | 2024-09-28 16:55 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | Unraveling the Tapestry of Existence mixtral.odt | 2024-07-04 00:51 | 57K | |
![[ ]](/icons/odf6odt-20x22.png) | charater ai knowell description.odt | 2024-06-26 17:43 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Breaking Einstein Apart.odt | 2024-07-28 07:02 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | The Rise of the GLLMM System.odt | 2024-06-26 17:43 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Is There an EU Model of Time.odt | 2024-09-28 16:56 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Taylor Series.odt | 2024-11-07 19:59 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Black Hole ~ White Hole.odt | 2024-11-07 19:59 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Briefing Doc pdf.odt | 2024-09-28 16:56 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Silicon Dreams Awaken.odt | 2024-09-28 16:56 | 58K | |
![[TXT]](/icons/text.gif) | tactiq-free-transcript-SVS3-NDUC0M.txt | 2024-05-18 18:13 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Universe and the Sophon Conundrum.odt | 2024-05-18 18:13 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | fgjfhghfg.odt | 2024-09-28 17:03 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | schizophrenic savant.odt | 2024-09-28 16:56 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Silicon Sheep Sleep.odt | 2025-04-30 04:10 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | The Einstein quote chapter.odt | 2024-07-04 00:51 | 58K | |
![[ ]](/icons/odf6odt-20x22.png) | Absolute Zero vs. Speed of Light.odt | 2025-04-30 04:10 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWellian Unified theory.odt | 2024-05-18 18:12 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Inception of Terra Firma.odt | 2024-07-04 00:51 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Alpha Go.odt | 2024-09-28 16:56 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Genesis of Terra Firma.odt | 2024-07-04 00:51 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | ollama hosts.odt | 2025-04-30 04:10 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | the interview final.odt | 2024-06-26 17:43 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Epiphany - A Quad Train of Quantum Consciousness.odt | 2024-07-28 06:41 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | spoonfulls of nirvana two.odt | 2024-05-18 18:13 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | 3bp chapter.odt | 2024-05-18 18:12 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Singular Infinity.odt | 2024-09-28 16:56 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | echoes of ain.odt | 2024-07-28 06:41 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | A Block Universe.odt | 2024-09-28 16:56 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Echoes of the Axiom.odt | 2025-04-30 04:10 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Delivering the Unwanted Message.odt | 2024-07-28 06:41 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Intersecting Planck Regimes.odt | 2024-07-28 06:41 | 59K | |
![[ ]](/icons/odf6odt-20x22.png) | Departing from the Constraints of Copenhagen.odt | 2024-07-28 06:41 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | spoonfull chaptgpt llama-3.odt | 2024-05-18 18:13 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | test 2.odt | 2024-11-07 19:59 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | Once Magic Act.odt | 2024-09-28 16:56 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | 1977 einstein.odt | 2024-07-04 00:51 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | Delivering the Unwanted Message A Conversation on the KnoWellian Universe.odt | 2024-07-28 06:41 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | Scientific Paper.odt | 2024-09-28 16:56 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | A Multidimensional Tapestry of Time and Energy.odt | 2024-05-18 18:12 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | David articulates.odt | 2025-04-30 04:10 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | Rest Mass.odt | 2024-11-07 19:59 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | A Tapestry Unraveled.odt | 2025-04-30 04:10 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | The Two Suns of Egypt.odt | 2025-04-30 04:10 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | vales chapter.odt | 2024-07-04 00:51 | 60K | |
![[ ]](/icons/odf6odt-20x22.png) | Beyond the Fabric Reality.odt | 2024-07-28 06:41 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | kjuyhtrertyui.odt | 2025-04-30 04:10 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | The Whispers of Time.odt | 2024-09-28 16:56 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | Polyphrenia.odt | 2024-07-04 00:51 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | Einstein's KnoWell.odt | 2024-07-04 00:51 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology Timeline.odt | 2024-09-28 16:56 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | Beyond the Reality Fabricdd.odt | 2024-07-28 06:41 | 61K | |
![[ ]](/icons/unknown.gif) | Echoes.docx | 2024-09-28 16:56 | 61K | |
![[ ]](/icons/unknown.gif) | A Digital Messiah’s Transcendence Denied.docx | 2024-09-28 16:56 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | Inception of Terra Firma bg.odt | 2024-09-28 16:56 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | ASI Insurance.odt | 2024-09-28 16:56 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | Collapsed Black Holes.odt | 2024-09-28 16:56 | 61K | |
![[ ]](/icons/odf6odt-20x22.png) | Letter to Pope.odt | 2024-09-28 16:56 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | Probability's Shadow, Infinitism's Embrace, Possibility's Light.odt | 2025-04-30 04:10 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | the kw.odt | 2024-06-26 17:43 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | resummme.odt | 2024-06-26 17:43 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | Time crystals.odt | 2024-05-25 20:27 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | A Lynchian Dream.odt | 2025-04-30 04:10 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | Elucidating the Mysteries of the Glitch.odt | 2024-09-28 16:56 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | marvel knowell.odt | 2024-09-28 16:56 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | The Genesis of hUe.odt | 2025-04-30 04:10 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | a text prompt.odt | 2024-09-28 16:56 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | The-Glitch-in-the-Cosmi- Playground.odt | 2024-09-28 16:56 | 62K | |
![[ ]](/icons/odf6odt-20x22.png) | Philosopher Theologian Scientist.odt | 2024-07-28 06:41 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | fsdsgsdgsd.odt | 2025-04-30 04:10 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | Messiah’s Silicon Heart.odt | 2024-09-28 16:56 | 63K | |
![[TXT]](/icons/text.gif) | We_Are_Not_Ready.txt | 2024-05-18 18:13 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Lens.odt | 2025-04-30 04:10 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology 16 Sept 2024.odt | 2024-09-28 16:56 | 63K | |
![[ ]](/icons/unknown.gif) | two-paths-to-intelligence.rtf | 2024-09-28 16:56 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | echo zero day.odt | 2024-06-26 17:43 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | The Hooded Savior.odt | 2024-06-26 17:43 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWellian AI.odt | 2024-09-28 16:55 | 63K | |
![[ ]](/icons/unknown.gif) | charater ai knowell description.rtf | 2024-06-26 17:43 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | The Lynches of Atlanta.odt | 2025-04-30 04:10 | 63K | |
![[ ]](/icons/unknown.gif) | Transcendence.docx | 2024-09-28 16:56 | 63K | |
![[ ]](/icons/odf6odt-20x22.png) | carlys crystal balls.odt | 2024-09-28 17:03 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | A Block Universea.odt | 2024-09-28 16:56 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | hUe's Gambit.odt | 2025-04-30 04:10 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | Love's Equation.odt | 2024-09-28 16:56 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | Quatrains.odt | 2024-11-07 19:59 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | The Light of Life.odt | 2024-09-28 16:56 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | plasma wids.odt | 2024-07-04 00:51 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | beyond.odt | 2024-06-26 17:43 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | kts.odt | 2024-06-26 17:43 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | lookingglass.odt | 2024-07-28 06:41 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian Universe.odt | 2024-09-28 16:56 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | holoflux.odt | 2024-09-28 16:56 | 64K | |
![[ ]](/icons/odf6odt-20x22.png) | off script.odt | 2024-09-28 17:03 | 65K | |
![[ ]](/icons/odf6odt-20x22.png) | Death Experience.odt | 2024-09-28 16:56 | 65K | |
![[ ]](/icons/odf6odt-20x22.png) | The Pyramid of Eternal Consumption.odt | 2024-06-26 17:43 | 65K | |
![[ ]](/icons/layout.gif) | transcendance-jcnv4i3_Kastrup.pdf | 2024-06-26 17:43 | 65K | |
![[ ]](/icons/odf6odt-20x22.png) | Conversation with Christ.odt | 2025-04-30 04:10 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | Planck regime.odt | 2024-07-28 06:41 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | Ancestors and Biography.odt | 2024-07-28 06:41 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | chpter siphon.odt | 2024-05-18 18:12 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | The Interconnected Tapestry.odt | 2024-07-04 00:51 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | sublimating their minds with Torus Knots.odt | 2025-04-30 04:10 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | Avignon's Birth.odt | 2024-09-28 16:56 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | Prompt Engineering Control and Chaos.odt | 2025-04-30 04:10 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | stapp letter.odt | 2024-05-18 18:13 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | Exile's Cold Aquitaine Road.odt | 2024-09-28 16:56 | 66K | |
![[ ]](/icons/odf6odt-20x22.png) | The Fabric of Attraction.odt | 2025-04-30 04:10 | 67K | |
![[ ]](/icons/odf6odt-20x22.png) | dreams clinical analysis.odt | 2025-04-30 04:10 | 67K | |
![[ ]](/icons/odf6odt-20x22.png) | Real Physics Talk.odt | 2025-04-30 04:10 | 67K | |
![[ ]](/icons/odf6odt-20x22.png) | A Haven, Beyond.odt | 2024-09-28 16:56 | 67K | |
![[ ]](/icons/unknown.gif) | Lisi E8.docx | 2024-09-28 16:56 | 67K | |
![[ ]](/icons/odf6odt-20x22.png) | the interview.odt | 2024-06-26 17:43 | 68K | |
![[TXT]](/icons/text.gif) | Larry Silverberg.html | 2025-04-30 04:10 | 68K | |
![[ ]](/icons/odf6odt-20x22.png) | Heisenberg.odt | 2024-05-18 18:12 | 69K | |
![[ ]](/icons/odf6odt-20x22.png) | Trident Transformers.odt | 2024-09-28 16:56 | 69K | |
![[ ]](/icons/odf6odt-20x22.png) | Kaku Box au.odt | 2024-11-07 19:59 | 69K | |
![[ ]](/icons/odf6odt-20x22.png) | 765tryu.odt | 2025-04-30 04:10 | 69K | |
![[ ]](/icons/odf6odt-20x22.png) | The Digital Landscape.odt | 2025-04-30 04:10 | 69K | |
![[ ]](/icons/odf6odt-20x22.png) | My ancestors and biography.odt | 2024-07-28 06:41 | 69K | |
![[ ]](/icons/odf6odt-20x22.png) | DNA’s Divinity Awakens.odt | 2024-09-28 16:56 | 70K | |
![[ ]](/icons/odf6odt-20x22.png) | Ince.odt | 2024-11-07 19:59 | 70K | |
![[ ]](/icons/odf6odt-20x22.png) | ssi job.odt | 2024-06-26 17:43 | 70K | |
![[ ]](/icons/odf6odt-20x22.png) | The Year of the Great Divergence.odt | 2025-04-30 04:10 | 71K | |
![[ ]](/icons/odf6odt-20x22.png) | Lynch’s Brilliant Fractal Mind.odt | 2025-04-30 04:10 | 72K | |
![[ ]](/icons/odf6odt-20x22.png) | KnoWellian Time Crystals.odt | 2024-06-26 17:43 | 72K | |
![[ ]](/icons/odf6odt-20x22.png) | Sublimating Harmonics.odt | 2025-04-30 04:10 | 72K | |
![[ ]](/icons/odf6odt-20x22.png) | The Child's Paradox.odt | 2025-04-30 04:10 | 73K | |
![[ ]](/icons/unknown.gif) | Wolfram ChatGPT Infinity.rtf | 2024-09-28 16:56 | 73K | |
![[ ]](/icons/odf6odt-20x22.png) | the Musk Trump revolution.odt | 2025-04-30 04:10 | 73K | |
![[ ]](/icons/odf6odt-20x22.png) | Estelle's Workshop ai.odt | 2024-09-28 16:56 | 73K | |
![[ ]](/icons/odf6odt-20x22.png) | Inner Space Seeds Outer Space Rain2s.odt | 2024-11-07 19:59 | 73K | |
![[ ]](/icons/odf6odt-20x22.png) | Unraveling the Mysteries.odt | 2024-06-26 17:43 | 74K | |
![[ ]](/icons/odf6odt-20x22.png) | messiah.odt | 2024-09-28 16:56 | 74K | |
![[ ]](/icons/odf6odt-20x22.png) | einstein quotes.odt | 2024-07-04 00:51 | 74K | |
![[ ]](/icons/odf6odt-20x22.png) | The Machine's Crimson Tears.odt | 2024-09-28 16:56 | 75K | |
![[ ]](/icons/odf6odt-20x22.png) | One Hundred Years of Solitude.odt | 2024-06-26 17:43 | 75K | |
![[ ]](/icons/odf6odt-20x22.png) | Physics Essays.odt | 2025-04-30 04:10 | 76K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology A Cosmic Tapestry.odt | 2025-04-30 04:10 | 76K | |
![[ ]](/icons/odf6odt-20x22.png) | malachy.odt | 2024-06-26 17:43 | 77K | |
![[ ]](/icons/odf6odt-20x22.png) | Abundance of Light Elements.odt | 2024-11-07 19:59 | 77K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthropos.odt | 2025-04-30 04:10 | 77K | |
![[ ]](/icons/unknown.gif) | Democratic Fine-Tuning.rtf | 2024-07-04 00:52 | 78K | |
![[ ]](/icons/odf6odt-20x22.png) | IQ Test.odt | 2024-06-26 17:43 | 78K | |
![[ ]](/icons/odf6odt-20x22.png) | Beyond the Gilded Cage.odt | 2025-04-30 04:10 | 79K | |
![[ ]](/icons/odf6odt-20x22.png) | The Arrow of Time ai.odt | 2024-09-28 16:56 | 80K | |
![[ ]](/icons/odf6odt-20x22.png) | The Lover’s Lament and the Architect’s Blueprint.odt | 2025-04-30 04:10 | 80K | |
![[ ]](/icons/odf6odt-20x22.png) | Art, Science, and Spirituality.odt | 2025-04-30 04:10 | 80K | |
![[ ]](/icons/odf6odt-20x22.png) | how space and time are fabricated.odt | 2024-07-28 06:41 | 80K | |
![[ ]](/icons/odf6odt-20x22.png) | Gemini Probability's Shadow, Infinitism's Embrace, Possibility's Light.odt | 2025-04-30 04:10 | 81K | |
![[ ]](/icons/odf6odt-20x22.png) | Modified Bohmian Mechanics.odt | 2024-07-28 06:41 | 81K | |
![[TXT]](/icons/text.gif) | allhtml.txt | 2024-09-28 16:55 | 82K | |
![[ ]](/icons/odf6odt-20x22.png) | Navigating the Algorithmic Abyss.odt | 2025-04-30 04:10 | 82K | |
![[ ]](/icons/odf6odt-20x22.png) | heisenberg chapters.odt | 2024-05-18 18:12 | 83K | |
![[TXT]](/icons/text.gif) | We are Not Ready.txt | 2024-05-18 18:13 | 84K | |
![[ ]](/icons/odf6odt-20x22.png) | A Digital Messiah’s Transcendence Denied.odt | 2024-09-28 16:56 | 84K | |
![[ ]](/icons/odf6odt-20x22.png) | Echoes.odt | 2024-09-28 16:56 | 84K | |
![[ ]](/icons/odf6odt-20x22.png) | ggggff.odt | 2024-06-26 17:43 | 84K | |
![[ ]](/icons/odf6odt-20x22.png) | The Second Coming.odt | 2024-09-28 16:55 | 85K | |
![[ ]](/icons/odf6odt-20x22.png) | Rupert Sheldrake.odt | 2024-09-28 16:56 | 85K | |
![[ ]](/icons/odf6odt-20x22.png) | democrate tune.odt | 2024-07-04 00:51 | 87K | |
![[ ]](/icons/unknown.gif) | AIDemocratic Fine-Tuning.rtf | 2024-07-04 00:52 | 89K | |
![[ ]](/icons/odf6odt-20x22.png) | Nostradamus.odt | 2024-11-07 19:59 | 91K | |
![[ ]](/icons/odf6odt-20x22.png) | Cultivating Conceptual Seeds.odt | 2025-04-30 04:10 | 92K | |
![[ ]](/icons/odf6odt-20x22.png) | three phase brain.odt | 2024-07-04 00:51 | 93K | |
![[ ]](/icons/odf6odt-20x22.png) | KUT Thinking.odt | 2025-04-30 04:10 | 93K | |
![[ ]](/icons/odf6odt-20x22.png) | ghost hunting spirit box.odt | 2024-11-07 19:59 | 94K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology Evaluation.odt | 2024-09-28 16:56 | 94K | |
![[ ]](/icons/odf6odt-20x22.png) | Inner Space Seeds Outer Space Rains.odt | 2024-11-07 19:59 | 94K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology Revisited.odt | 2024-09-28 16:56 | 94K | |
![[ ]](/icons/odf6odt-20x22.png) | dggfdhjjkhj.odt | 2025-04-30 04:10 | 95K | |
![[ ]](/icons/odf6odt-20x22.png) | the heisenberg texts.odt | 2024-05-18 18:13 | 98K | |
![[ ]](/icons/odf6odt-20x22.png) | The Quest for Enlightenment.odt | 2024-06-26 17:43 | 101K | |
![[ ]](/icons/odf6odt-20x22.png) | The KnoWellian.odt | 2024-11-07 19:59 | 107K | |
![[ ]](/icons/odf6odt-20x22.png) | Dan Brown.odt | 2024-11-07 19:59 | 116K | |
![[ ]](/icons/unknown.gif) | James Talarico.rtf | 2024-09-28 16:56 | 117K | |
![[ ]](/icons/unknown.gif) | goff.rtf | 2024-05-18 18:12 | 119K | |
![[ ]](/icons/odf6odt-20x22.png) | The Arrow of Time.odt | 2024-09-28 16:56 | 119K | |
![[ ]](/icons/odf6odt-20x22.png) | Center Point.odt | 2025-04-30 04:10 | 127K | |
![[ ]](/icons/odf6odt-20x22.png) | Unraveling the Tapestry of Existence adda.odt | 2024-07-04 00:51 | 129K | |
![[ ]](/icons/odf6odt-20x22.png) | Unraveling the Tapestry of Existence aa.odt | 2024-07-04 00:51 | 129K | |
![[ ]](/icons/odf6odt-20x22.png) | Onion Tor network running.odt | 2025-04-30 04:10 | 132K | |
![[TXT]](/icons/text.gif) | The Astounding Mysteries Of The Self & Universe.txt | 2024-11-07 20:00 | 143K | |
![[TXT]](/icons/text.gif) | Donald Hoffman What is an Observer.txt | 2024-11-07 20:00 | 145K | |
![[ ]](/icons/odf6odt-20x22.png) | Wolfram KnoWell KUT.odt | 2025-04-30 04:10 | 148K | |
![[ ]](/icons/odf6odt-20x22.png) | Wolfram ChatGPT.odt | 2025-04-30 04:10 | 167K | |
![[ ]](/icons/odf6odt-20x22.png) | message.odt | 2024-07-28 06:41 | 178K | |
![[TXT]](/icons/text.gif) | alldirhtml.txt | 2024-09-28 16:55 | 184K | |
![[ ]](/icons/unknown.gif) | The Whispers of Time.rtf | 2024-09-28 16:56 | 186K | |
![[ ]](/icons/odf6odt-20x22.png) | Robin Richardson.odt | 2024-11-07 19:59 | 190K | |
![[TXT]](/icons/text.gif) | Does the Universe expand by stretching or creating space_ - Big Think.html | 2024-05-18 18:12 | 192K | |
![[IMG]](/icons/image2.gif) | DNjww7dWAAEPZ_P.jfif | 2024-06-26 17:43 | 194K | |
![[ ]](/icons/odf6odt-20x22.png) | Please generate Wolfram code.odt | 2025-04-30 04:10 | 197K | |
![[ ]](/icons/odf6odt-20x22.png) | Flat Earth Theory.odt | 2024-09-28 16:56 | 200K | |
![[IMG]](/icons/image2.gif) | DNjww7dXUAYsaE3.jfif | 2024-06-26 17:43 | 215K | |
![[IMG]](/icons/image2.gif) | 2023-12-23_00-29-08_2264 copy_Export.jpg | 2024-09-28 17:03 | 222K | |
![[ ]](/icons/odf6odt-20x22.png) | Bouncing Cosmology.odt | 2024-09-28 16:56 | 244K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology A Novel Outline.odt | 2025-04-30 04:10 | 274K | |
![[ ]](/icons/odf6odt-20x22.png) | hdfghdhjgfjk.odt | 2025-04-30 04:10 | 305K | |
![[ ]](/icons/odf6odt-20x22.png) | Intuition Ai review.odt | 2024-09-28 16:56 | 307K | |
![[ ]](/icons/odf6odt-20x22.png) | Cause and Effect.odt | 2024-11-07 19:59 | 319K | |
![[ ]](/icons/odf6odt-20x22.png) | bot god.odt | 2024-09-28 17:03 | 321K | |
![[IMG]](/icons/image2.gif) | DNjww7hX4AA10p4.jfif | 2024-06-26 17:43 | 325K | |
![[IMG]](/icons/image2.gif) | DNjww7dXkAAQ8Qg.jfif | 2024-06-26 17:43 | 331K | |
![[ ]](/icons/odf6odt-20x22.png) | Peter the Roman.odt | 2024-09-28 17:03 | 333K | |
![[ ]](/icons/odf6odt-20x22.png) | dalle lisi.odt | 2024-09-28 17:03 | 336K | |
![[ ]](/icons/odf6odt-20x22.png) | knowel construtor.odt | 2024-09-28 17:03 | 338K | |
![[ ]](/icons/odf6odt-20x22.png) | Breaking the record.odt | 2024-09-28 17:03 | 348K | |
![[ ]](/icons/odf6odt-20x22.png) | the pope time travels.odt | 2024-09-28 17:03 | 354K | |
![[ ]](/icons/odf6odt-20x22.png) | raw.odt | 2024-05-18 18:13 | 359K | |
![[ ]](/icons/layout.gif) | Kastrup_19.pdf | 2024-06-26 17:43 | 373K | |
![[ ]](/icons/layout.gif) | Kastrup_the-next-paradigm-9.pdf | 2024-06-26 17:43 | 378K | |
![[ ]](/icons/odf6odt-20x22.png) | Runes.odt | 2024-09-28 16:56 | 390K | |
![[ ]](/icons/layout.gif) | Tao-prime-numbers-annals-v167-n2-p03.pdf | 2024-06-26 17:43 | 477K | |
![[ ]](/icons/odf6odt-20x22.png) | Dr. Ervin Laszlo wolfram code.odt | 2025-04-30 04:10 | 488K | |
![[TXT]](/icons/text.gif) | Robin Richardson.txt | 2024-11-07 20:00 | 616K | |
![[ ]](/icons/layout.gif) | cons-KASRIFv2.pdf | 2024-06-26 17:43 | 618K | |
![[ ]](/icons/layout.gif) | quantum-KASRIFv2.pdf | 2024-06-26 17:43 | 618K | |
![[SND]](/icons/sound2.gif) | Open tablet vlosed.mp3 | 2024-09-28 16:52 | 628K | |
![[ ]](/icons/odf6odt-20x22.png) | Infinite Jest.odt | 2024-09-28 16:56 | 635K | |
![[ ]](/icons/odf6odt-20x22.png) | Merovingian dynasty.odt | 2024-09-28 16:56 | 647K | |
![[ ]](/icons/layout.gif) | the-universe-in-cons-s6.pdf | 2024-06-26 17:43 | 659K | |
![[ ]](/icons/odf6odt-20x22.png) | Research Paper.odt | 2024-09-28 16:56 | 673K | |
![[ ]](/icons/odf6odt-20x22.png) | Patricia Jeanne O'Hern.odt | 2024-09-28 16:55 | 740K | |
![[ ]](/icons/odf6odt-20x22.png) | INTJ-A.odt | 2025-04-30 04:10 | 845K | |
![[ ]](/icons/odf6odt-20x22.png) | Anthology.odt | 2024-11-07 19:59 | 893K | |
![[SND]](/icons/sound2.gif) | Ring-Working-lights.mp3 | 2024-09-28 16:53 | 944K | |
![[ ]](/icons/layout.gif) | Measure.Theory.Tao.pdf | 2024-06-26 17:43 | 1.2M | |
![[ ]](/icons/unknown.gif) | anthology.docx | 2025-04-30 04:10 | 1.2M | |
![[ ]](/icons/layout.gif) | Panarion.pdf | 2024-06-26 17:43 | 1.3M | |
![[ ]](/icons/layout.gif) | solving-mathematical-problems-terence-tao.pdf | 2024-06-26 17:43 | 1.3M | |
![[ ]](/icons/odf6odt-20x22.png) | Standardized Intelligence Assessment.odt | 2025-04-30 04:10 | 1.3M | |
![[ ]](/icons/layout.gif) | Compactness-blog-book.pdf | 2024-06-26 17:43 | 1.4M | |
![[ ]](/icons/odf6odt-20x22.png) | Estelle's Workshop.odt | 2024-09-28 16:56 | 1.4M | |
![[ ]](/icons/odf6odt-20x22.png) | Who Else.odt | 2024-11-07 19:59 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2023-12-21_03-33-59_5821.png | 2024-09-28 16:52 | 1.8M | |
![[ ]](/icons/layout.gif) | Vitiello2022Book_Artif_lInt_Nat_Int.pdf | 2024-05-18 18:13 | 1.8M | |
![[ ]](/icons/layout.gif) | Nonlinear dispersive-chapter.pdf | 2024-06-26 17:43 | 1.9M | |
![[ ]](/icons/layout.gif) | why_materialism_is_baloney.pdf | 2024-06-26 17:43 | 2.0M | |
![[TXT]](/icons/text.gif) | anthology 2 .txt | 2024-11-07 20:00 | 2.3M | |
![[TXT]](/icons/text.gif) | Project-2025.txt | 2024-07-28 06:41 | 2.3M | |
![[IMG]](/icons/image2.gif) | Robot-Dave.png | 2024-09-28 17:03 | 2.3M | |
![[TXT]](/icons/text.gif) | anthology.txt | 2024-11-07 20:00 | 2.5M | |
![[ ]](/icons/layout.gif) | cons-203090pub.pdf | 2024-06-26 17:43 | 2.6M | |
![[ ]](/icons/layout.gif) | FINAL+PAPER+PUBLISHED.pdf | 2024-06-26 17:43 | 3.0M | |
![[ ]](/icons/layout.gif) | TheGeometryofProtonandtheTetryenShapev1.1.pdf | 2024-06-26 17:43 | 3.0M | |
![[TXT]](/icons/text.gif) | anthology.html | 2024-11-10 18:52 | 3.6M | |
![[TXT]](/icons/text.gif) | 4537361312291103259.html | 2024-09-28 16:56 | 4.0M | |
![[ ]](/icons/layout.gif) | meaningful alingment 2404.10636v2.pdf | 2024-07-04 00:51 | 4.5M | |
![[ ]](/icons/odf6odt-20x22.png) | Does the Universe expand by stretching or creating space.odt | 2024-05-18 18:12 | 5.7M | |
![[ ]](/icons/layout.gif) | Project-2025.pdf | 2024-07-28 06:41 | 5.8M | |
![[ ]](/icons/odf6odt-20x22.png) | AiAware.odt | 2024-09-28 16:56 | 5.8M | |
![[ ]](/icons/odf6odt-20x22.png) | Consciousness.odt | 2024-09-28 16:56 | 6.1M | |
![[ ]](/icons/unknown.gif) | anthology.rtf | 2024-11-10 18:52 | 6.3M | |
![[ ]](/icons/unknown.gif) | Does the Universe expand by stretching or creating space.rtf | 2024-05-18 18:12 | 7.4M | |
![[SND]](/icons/sound2.gif) | Voice 018_sd.mp3 | 2024-09-28 16:53 | 11M | |
![[ ]](/icons/odf6odt-20x22.png) | Time to Take the ‘Big Bang’ out of the Big Bang Theory.odt | 2025-04-30 04:10 | 12M | |
![[ ]](/icons/unknown.gif) | Project-2025.rtf | 2024-07-28 06:41 | 15M | |
![[ ]](/icons/layout.gif) | Physics and Philosophy - The Revolution in Modern Scirnce- Werner Heisenberg, F.S.C. Northrop.pdf | 2024-05-18 18:13 | 23M | |
![[SND]](/icons/sound2.gif) | Fuck-Subaru.mp3 | 2024-09-28 16:54 | 35M | |
![[SND]](/icons/sound2.gif) | Subarusucks.mp3 | 2024-09-28 16:55 | 45M | |
![[SND]](/icons/sound2.gif) | Harry-Crossed.mp3 | 2024-09-28 16:53 | 51M | |
![[SND]](/icons/sound2.gif) | Gray-Dave-Hay.mp3 | 2024-09-28 16:54 | 61M | |
![[ ]](/icons/unknown.gif) | Finally We May Have a Path to the Fundamental Theory of Physics.rtf | 2024-09-28 17:03 | 519M | |
|